Dataset
Noramidopyrine; LC-ESI-QTOF; MS2; 20 V
Chemical Information
| InChI | InChI=1S/C12H15N3O/c1-9-11(13-2)12(16)15(14(9)3)10-7-5-4-6-8-10/h4-8,13H,1-3H3 |
|---|---|
| SMILES | CC1=C(C(=O)N(N1C)C2=CC=CC=C2)NC |
| InChI Key | JILCEWWZTBBOFS-UHFFFAOYSA-N |
| Molecular Formula | C12H15N3O |
| Exact Mass | 217.121 g/mol |
Data and Resources
Metadata Information
| Field | Value |
|---|---|
| DOI | |
| License URL | |
| Source | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-BAFG-CSL23111016453 |
| Version | |
| Author | |
| Maintainer | |
| Language | |
| MetadataPublished | 2023-11-10 |
| Related Molecule |
|
| Field | Value |
|---|---|
| Measurement Technique | liquid chromatography-mass spectrometry |
| Measurement Variables |
| Data-Source Molecule ID | Data-Source |
|---|---|
| SCHEMBL537958 | SureChEMBL |
| MCULE-6328142081 | Mcule |
| 32147 | Brenda |
| HMDB0013839 | Human Metabolome Database |
| MTBLC73261 | Metabolights |
| PD127426 | ProbesDrugs |
| 80004443 | NMRShiftDB |
| NER31DE951 | FDA SRS |
| 14822589 | PubChem: Thomson Pharma |
| 73261 | ChEBI |
| 519-98-2 | ACToR |
| 1073601 | eMolecules |
| CHEMBL1164701 | ChEMBL |
| HY-135731 | MedChemExpress |
| DTXSID80199865 | EPA CompTox Dashboard |
| J25.268I | Nikkaji |
| 50360021 | BindingDB |
| ZINC000000121456 | ZINC |
| 10618 | PubChem |
| CB5924116 | ChemicalBook |
| The data in this table is sourced from UniChem at EBI. | |