Dataset
Didanosine; LC-ESI-Q; MS; POS; 75 V
Chemical Information
| InChI | InChI=1S/C10H12N4O3/c15-3-6-1-2-7(17-6)14-5-13-8-9(14)11-4-12-10(8)16/h4-7,15H,1-3H2,(H,11,12,16)/t6-,7+/m0/s1 |
|---|---|
| SMILES | OCC(C3)OC(C3)n(c2)c(n1)c(n2)c(O)nc1 |
| InChI Key | BXZVVICBKDXVGW-NKWVEPMBSA-N |
| Molecular Formula | C10H12N4O3 |
| Exact Mass | 236.091 g/mol |
Data and Resources
Metadata Information
| Field | Value |
|---|---|
| DOI | |
| License URL | https://creativecommons.org/licenses/by-nc/4.0 |
| Source | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-Waters-WA000418 |
| Version | |
| Author | |
| Maintainer | |
| Language | |
| MetadataPublished | 2016-01-19 |
| Related Molecule |
|
| Field | Value |
|---|---|
| Measurement Technique | liquid chromatography-mass spectrometry |
| Measurement Variables |
| Data-Source Molecule ID | Data-Source |
|---|---|
| 50404252 | BindingDB |
| CUYDOQ | CCDC |
| J261.930J | Nikkaji |
| 869 | DrugCentral |
| DTXSID6022927 | EPA CompTox Dashboard |
| MCULE-2844514954 | Mcule |
| HY-B0249 | MedChemExpress |
| NSC-612049 | clinicaltrials |
| DIDANOSINE | clinicaltrials |
| BMY-40900 | clinicaltrials |
| VIDEX EC | rxnorm |
| DIDANOSINE | rxnorm |
| VIDEX | rxnorm |
| DIDANOSINE | DailyMed |
| 4833 | Guide to Pharmacology |
| 1813 | Brenda |
| K3GDH6OH08 | FDA SRS |
| 135398739 | PubChem |
| HMDB0015037 | Human Metabolome Database |
| 490877 | ChEBI |
| CHEMBL1460 | ChEMBL |
| SAM001246673 | NIH Clinical Collection |
| 12014245 | PubChem: Drugs of the Future |
| 2DI | PDBe |
| C06953 | KEGG Ligand |
| DB00900 | DrugBank |
| 51621 | Brenda |
| CB0680765 | ChemicalBook |
| PA449301 | PharmGKB |
| 124179 | Brenda |
| 14441 | Brenda |
| didanosine | DailyMed |
| ZINC000013597823 | ZINC |
| 148764 | Brenda |
| 15196316 | PubChem: Thomson Pharma |
| PD003179 | ProbesDrugs |
| LSM-6017 | LINCS |
| 69655-05-6 | ACToR |
| 14847321 | PubChem: Thomson Pharma |
| Didanosine(Videx) | Selleck |
| 15121787 | PubChem: Thomson Pharma |
| 15121788 | PubChem: Thomson Pharma |
| SCHEMBL3363 | SureChEMBL |
| 901757 | eMolecules |
| 1986517 | eMolecules |
| 2724662 | eMolecules |
| 30075948 | eMolecules |
| The data in this table is sourced from UniChem at EBI. | |