-
13C nuclear magnetic resonance spectroscopy (13C NMR) ((4-ethoxy-2-phenyl-1,3... Dataset
dataset for 13C nuclear magnetic resonance spectroscopy (13C NMR) -
C22H24N2O6S2 Dataset
This dataset contains experimental data from a sample (ethyl 4-ethoxy-2-[3-(4-ethoxy-5-ethoxycarbonyl-1,3-thiazol-2-yl)phenyl]-1,3-thiazole-5-carboxylate,... -
infrared absorption spectroscopy (IR) (ethyl 4-ethoxy-2-[3-(4-ethoxy-5-ethoxy... Dataset
dataset for infrared absorption spectroscopy (IR) -
mass spectrometry (MS) (ethyl 4-ethoxy-2-[3-(4-ethoxy-5-ethoxycarbonyl-1,3-th... Dataset
dataset for mass spectrometry (MS) -
1H nuclear magnetic resonance spectroscopy (1H NMR) (ethyl 4-ethoxy-2-[3-(4-e... Dataset
dataset for 1H nuclear magnetic resonance spectroscopy (1H NMR) -
13C nuclear magnetic resonance spectroscopy (13C NMR) (ethyl 4-ethoxy-2-[3-(4... Dataset
dataset for 13C nuclear magnetic resonance spectroscopy (13C NMR) -
C17H15N3O6S2 Dataset
This dataset contains experimental data from a sample (ethyl 2-[6-(5-ethoxycarbonyl-4-hydroxy-1,3-thiazol-2-yl)pyridin-2-yl]-4-hydroxy-1,3-thiazole-5-carboxylate,... -
mass spectrometry (MS) (ethyl 2-[6-(5-ethoxycarbonyl-4-hydroxy-1,3-thiazol-2-... Dataset
dataset for mass spectrometry (MS) -
1H nuclear magnetic resonance spectroscopy (1H NMR) (ethyl 2-[6-(5-ethoxycarb... Dataset
dataset for 1H nuclear magnetic resonance spectroscopy (1H NMR) -
13C nuclear magnetic resonance spectroscopy (13C NMR) (ethyl 2-[6-(5-ethoxyca... Dataset
dataset for 13C nuclear magnetic resonance spectroscopy (13C NMR) -
C12H11NO2S Dataset
This dataset contains experimental data from a sample (4-ethoxy-2-phenyl-1,3-thiazole-5-carbaldehyde,... -
distortionless enhancement with polarization transfer (DEPT) (4-ethoxy-2-phen... Dataset
dataset for distortionless enhancement with polarization transfer (DEPT) -
1H nuclear magnetic resonance spectroscopy (1H NMR) (4-ethoxy-2-phenyl-1,3-th... Dataset
dataset for 1H nuclear magnetic resonance spectroscopy (1H NMR) -
mass spectrometry (MS) (4-ethoxy-2-phenyl-1,3-thiazole-5-carbaldehyde) Dataset
dataset for mass spectrometry (MS) -
infrared absorption spectroscopy (IR) (4-ethoxy-2-phenyl-1,3-thiazole-5-carba... Dataset
dataset for infrared absorption spectroscopy (IR) -
13C nuclear magnetic resonance spectroscopy (13C NMR) (4-ethoxy-2-phenyl-1,3-... Dataset
dataset for 13C nuclear magnetic resonance spectroscopy (13C NMR) -
C10H8ClNS Dataset
This dataset contains experimental data from a sample (4-chloro-5-methyl-2-phenyl-1,3-thiazole, InChI=1S/C10H8ClNS/c1-7-9(11)12-10(13-7)8-5-3-2-4-6-8/h2-6H,1H3). -
infrared absorption spectroscopy (IR) (4-chloro-5-methyl-2-phenyl-1,3-thiazole) Dataset
dataset for infrared absorption spectroscopy (IR) -
1H nuclear magnetic resonance spectroscopy (1H NMR) (4-chloro-5-methyl-2-phen... Dataset
dataset for 1H nuclear magnetic resonance spectroscopy (1H NMR) -
mass spectrometry (MS) (4-chloro-5-methyl-2-phenyl-1,3-thiazole) Dataset
dataset for mass spectrometry (MS)