Dataset
Isoquercitrin 400 MHz in DMSOd6 NMR data[Isoquercitrin_3060ug200uL_DMSOd6_HMBC_400MHz_JDX.jdx]
Chemical Information
| InChI | InChI=1S/C21H20O12/c22-6-13-15(27)17(29)18(30)21(32-13)33-20-16(28)14-11(26)4-8(23)5-12(14)31-19(20)7-1-2-9(24)10(25)3-7/h1-5,13,15,17-18,21-27,29-30H,6H2/t13-,15-,17+,18-,21+/m1/s1 |
|---|---|
| SMILES | O=C1C(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)=C(C2=CC(O)=C(O)C=C2)OC2=CC(O)=CC(O)=C12 |
| InChI Key | OVSQVDMCBVZWGM-QSOFNFLRSA-N |
| Molecular Formula | C21H20O12 |
| Exact Mass | 464.400 g/mol |
Data and Resources
Metadata Information
| Field | Value |
|---|---|
| DOI | 10.57992/nmrxiv.p33.s225.d1279 |
| License URL | https://creativecommons.org/publicdomain/zero/1.0/legalcode |
| Source | https://nmrxiv.org/D1279 |
| Version | |
| Author | Bisson J, McAlpine JB, Friesen JB, Chen SN, Graham J, Pauli GF. |
| Maintainer | |
| Language | english |
| MetadataPublished | 2023-12-21T14:26:13.000000Z |
| Related Molecule |
|
| Field | Value |
|---|---|
| Measurement Technique | heteronuclear multiple bond coherence |
| Measurement Variables |
|
| Data-Source Molecule ID | Data-Source |
|---|---|
| DB12665 | drugbank |
| CHEBI:68352 | chebi |
| LMPK12112086 | lipidmaps |
| HW2 | rcsb_pdb |
| CHEMBL250450 | chembl |
| 181306 | surechembl |
| 29349832 | surechembl |
| 29354754 | surechembl |
| 5280804 | pubchem |
| 6HN2PC637T | fdasrs |
| HW2 | pdbe |
| PD002964 | probes_and_drugs |
| 15801 | brenda |
| 17635 | brenda |
| 249131 | brenda |
| 249134 | brenda |
| 259767 | brenda |
| 4048 | brenda |
| 49388 | brenda |
| 49389 | brenda |
| 4984 | brenda |
| 56650 | brenda |
| 56778 | brenda |
| 5785 | brenda |
| 60676 | brenda |
| 66051 | brenda |
| 66580 | brenda |
| HMDB0037362 | hmdb |
| Molport-001-740-247 | molport |
| 153265 | bindingdb |
| The data in this table is sourced from UniChem at EBI. | |