Dataset
![molecular Image]()
Coenzyme Q10
Chemical Info
| InChI | InChI=1S/C59H90O4/c1-44(2)24-15-25-45(3)26-16-27-46(4)28-17-29-47(5)30-18-31-48(6)32-19-33-49(7)34-20-35-50(8)36-21-37-51(9)38-22-39-52(10)40-23-41-53(11)42-43-55-54(12)56(60)58(62-13)59(63-14)57(55)61/h24,26,28,30,32,34,36,38,40,42H,15-23,25,27,29,31,33,35,37,39,41,43H2,1-14H3/b45-26+,46-28+,47-30+,48-32+,49-34+,50-36+,51-38+,52-40+,53-42+ |
|---|---|
| SMILES | CC1=C(C(=O)C(=C(C1=O)OC)OC)C/C=C(\C)/CC/C=C(\C)/CC/C=C(\C)/CC/C=C(\C)/CC/C=C(\C)/CC/C=C(\C)/CC/C=C(\C)/CC/C=C(\C)/CC/C=C(\C)/CCC=C(C)C |
| InChI Key | ACTIUHUUMQJHFO-UPTCCGCDSA-N |
| Molecular Formula | C59H90O4 |
| Exact Mass | 862.684 g/mol |
Data and Resources
Metadata Information
| Field | Value |
|---|---|
| DOI | |
| License URL | https://creativecommons.org/licenses/by/4.0 |
| Source | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-Antwerp_Univ-METOX_N103007_F638 |
| Version | |
| Author | |
| Maintainer | |
| Language | |
| MetadataCreated | 2024-01-11T09:35:08.019428 |
| MetadataModified | 2025-02-08T18:50:48.326245 |
| MetadataPublished | 2022-04-07 |
| Field | Value |
|---|---|
| Measurement Technique | liquid chromatography-mass spectrometry |
| Measurement Variables |
| Data-Source Molecule ID | Data-Source |
|---|---|
| U10 | PDBe |
| C11378 | KEGG Ligand |
| 24714735 | PubChem: Drugs of the Future |
| CHEMBL454801 | ChEMBL |
| J11.405G | Nikkaji |
| J24.300K | Nikkaji |
| 4607 | DrugCentral |
| LMPR02010001 | LipidMaps |
| DTXSID6046054 | EPA CompTox Dashboard |
| DB09270 | DrugBank |
| HY-N0111 | MedChemExpress |
| UBIDECARENONE | clinicaltrials |
| API-31510 | clinicaltrials |
| API 31510 | clinicaltrials |
| UBIQUINONE 50 | clinicaltrials |
| BIO-QUINONE Q10 | clinicaltrials |
| UBIDECARENONE | rxnorm |
| UBIDECARENONE | DailyMed |
| SCHEMBL19858 | SureChEMBL |
| 46245 | ChEBI |
| 207267 | Brenda |
| ubidecarenone | DailyMed |
| 12479 | Brenda |
| 23162 | Brenda |
| 175567 | Brenda |
| 193478 | Brenda |
| HMDB0001072 | Human Metabolome Database |
| 46245 | Rhea |
| 13303 | Brenda |
| 148249 | Brenda |
| 21695 | Brenda |
| 5536 | Brenda |
| 136673 | Brenda |
| MTBLC46245 | Metabolights |
| ZINC000085427689 | ZINC |
| 493932 | eMolecules |
| 5281915 | PubChem |
| 60020705 | NMRShiftDB |
| PD004134 | ProbesDrugs |
| EJ27X76M46 | FDA SRS |
| 14791704 | PubChem: Thomson Pharma |
| 13448-14-1 | ACToR |
| Coenzyme-Q10-CoQ10 | Selleck |
| q10 | Recon |
| The data in this table is sourced from UniChem at EBI. | |