Dataset
![molecular Image]()
Prostaglandin E1
Chemical Info
| InChI | InChI=1S/C20H34O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h12-13,15-17,19,21,23H,2-11,14H2,1H3,(H,24,25)/b13-12+/t15-,16+,17+,19+/m0/s1 |
|---|---|
| SMILES | CCCCC[C@@H](/C=C/[C@H]1[C@@H](CC(=O)[C@@H]1CCCCCCC(=O)O)O)O |
| InChI Key | GMVPRGQOIOIIMI-DWKJAMRDSA-N |
| Molecular Formula | C20H34O5 |
| Exact Mass | 354.241 g/mol |
Data and Resources
Metadata Information
| Field | Value |
|---|---|
| DOI | |
| License URL | https://creativecommons.org/licenses/by/4.0 |
| Source | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-Antwerp_Univ-METOX_N108416_2347 |
| Version | |
| Author | |
| Maintainer | |
| Language | |
| MetadataCreated | 2024-01-11T09:39:35.191158 |
| MetadataModified | 2025-02-08T18:51:55.304534 |
| MetadataPublished | 2022-04-07 |
| Related Molecule |
| Field | Value |
|---|---|
| Measurement Technique | liquid chromatography-mass spectrometry |
| Measurement Variables |
| Data-Source Molecule ID | Data-Source |
|---|---|
| CHEMBL495 | ChEMBL |
| SAM001246840 | NIH Clinical Collection |
| 15544 | ChEBI |
| 12013405 | PubChem: Drugs of the Future |
| C04741 | KEGG Ligand |
| ALPROSTADIL | DailyMed |
| 50101853 | BindingDB |
| EDEX | rxnorm |
| PROSTIN VR | rxnorm |
| CAVERJECT | rxnorm |
| PROSTIN | clinicaltrials |
| PROSTIN VR PEDIATRIC | clinicaltrials |
| CAVERJECT | clinicaltrials |
| ALPROSTADIL | clinicaltrials |
| PROSTAGLANDIN E1 | clinicaltrials |
| PROSTAVASIN | clinicaltrials |
| HY-B0131 | MedChemExpress |
| LSM-42979 | LINCS |
| DTXSID9022578 | EPA CompTox Dashboard |
| LMFA03010134 | LipidMaps |
| 138 | DrugCentral |
| 1882 | Guide to Pharmacology |
| J3.319G | Nikkaji |
| PROSTE | CCDC |
| ALPROSTADIL | rxnorm |
| 5280723 | PubChem |
| SCHEMBL33317 | SureChEMBL |
| XPG | PDBe |
| 153410 | Brenda |
| 1654 | Brenda |
| 33678 | Brenda |
| ZINC000003813088 | ZINC |
| alprostadil | DailyMed |
| 154395 | Brenda |
| CB6141459 | ChemicalBook |
| HMDB0001442 | Human Metabolome Database |
| MTBLC15544 | Metabolights |
| 90230 | Brenda |
| 60020600 | NMRShiftDB |
| PD002898 | ProbesDrugs |
| DB00770 | DrugBank |
| F5TD010360 | FDA SRS |
| 14901056 | PubChem: Thomson Pharma |
| 119314-69-1 | ACToR |
| Alprostadil(Caverject) | Selleck |
| 14901054 | PubChem: Thomson Pharma |
| 745-65-3 | ACToR |
| 531173 | eMolecules |
| 29541183 | eMolecules |
| The data in this table is sourced from UniChem at EBI. | |