Dataset
Taurocholic acid; LC-ESI-QTOF; MS2; CE: 10eV; R=7000; [M-H2O+H]+
Chemical Information
| InChI | InChI=1S/C26H45NO7S/c1-15(4-7-23(31)27-10-11-35(32,33)34)18-5-6-19-24-20(14-22(30)26(18,19)3)25(2)9-8-17(28)12-16(25)13-21(24)29/h15-22,24,28-30H,4-14H2,1-3H3,(H,27,31)(H,32,33,34)/t15-,16+,17-,18-,19+,20+,21-,22+,24+,25+,26-/m1/s1 |
|---|---|
| SMILES | C[C@H](CCC(=O)NCCS(=O)(=O)O)[C@H]1CC[C@@H]2[C@@]1([C@H](C[C@H]3[C@H]2[C@@H](C[C@H]4[C@@]3(CC[C@H](C4)O)C)O)O)C |
| InChI Key | WBWWGRHZICKQGZ-HZAMXZRMSA-N |
| Molecular Formula | C26H45NO7S |
| Exact Mass | 515.292 g/mol |
Data and Resources
Metadata Information
| Field | Value |
|---|---|
| DOI | |
| License URL | https://creativecommons.org/licenses/by/4.0 |
| Source | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-Antwerp_Univ-METOX_N109414_E098 |
| Version | |
| Author | |
| Maintainer | |
| Language | |
| MetadataPublished | 2022-04-07 |
| Related Molecule |
|
| Field | Value |
|---|---|
| Measurement Technique | liquid chromatography-mass spectrometry |
| Measurement Variables |
| Data-Source Molecule ID | Data-Source |
|---|---|
| 28865 | ChEBI |
| CHEMBL224867 | ChEMBL |
| J8.603G | Nikkaji |
| 4547 | Guide to Pharmacology |
| 4546 | Guide to Pharmacology |
| LMST05040001 | LipidMaps |
| HY-B1788 | MedChemExpress |
| 50375594 | BindingDB |
| 230117 | Brenda |
| 230118 | Brenda |
| CB2133861 | ChemicalBook |
| 1260 | Brenda |
| 45181 | Brenda |
| 2289 | Brenda |
| DB04348 | DrugBank |
| DTXSID00883259 | EPA CompTox Dashboard |
| HMDB0000036 | Human Metabolome Database |
| ZINC000008214684 | ZINC |
| MTBLC28865 | Metabolights |
| 105693 | Brenda |
| 153413 | Brenda |
| 154398 | Brenda |
| tchola | Recon |
| LSM-5866 | LINCS |
| 15805741 | PubChem: Thomson Pharma |
| 6675 | PubChem |
| PD048547 | ProbesDrugs |
| 5E090O0G3Z | FDA SRS |
| TCH | PDBe |
| 113341-22-3 | ACToR |
| SCHEMBL3705 | SureChEMBL |
| The data in this table is sourced from UniChem at EBI. | |