Dataset
![molecular Image]()
L-Lysine standard
Chemical Info
| InChI | InChI=1S/C6H14N2O2/c7-4-2-1-3-5(8)6(9)10/h5H,1-4,7-8H2,(H,9,10)/t5-/m0/s1 |
|---|---|
| SMILES | C(CCN)C[C@@H](C(=O)O)N |
| InChI Key | KDXKERNSBIXSRK-YFKPBYRVSA-N |
| Molecular Formula | C6H14N2O2 |
| Exact Mass | 146.106 g/mol |
Data and Resources
Metadata Information
| Field | Value |
|---|---|
| DOI | |
| License URL | https://creativecommons.org/licenses/by/4.0 |
| Source | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-Antwerp_Univ-METOX_P100301_FB57 |
| Version | |
| Author | |
| Maintainer | |
| Language | |
| MetadataCreated | 2024-01-11T09:37:54.650255 |
| MetadataModified | 2025-02-08T18:51:50.585898 |
| MetadataPublished | 2021-12-23 |
| Related Molecule |
| Field | Value |
|---|---|
| Measurement Technique | liquid chromatography-mass spectrometry |
| Measurement Variables |
| Data-Source Molecule ID | Data-Source |
|---|---|
| 35486 | Brenda |
| 156607 | Brenda |
| 145943 | Brenda |
| 649 | Brenda |
| 145031 | Brenda |
| 111041 | Brenda |
| 6887 | Brenda |
| 171012 | Brenda |
| 502 | Brenda |
| 1107 | Brenda |
| HMDB0000182 | Human Metabolome Database |
| PA450280 | PharmGKB |
| CB4492106 | ChemicalBook |
| lysine | DailyMed |
| MTBLC133538 | Metabolights |
| 217367 | BindingDB |
| MTBLC18019 | Metabolights |
| 134 | Brenda |
| 106418 | Brenda |
| 88205 | Brenda |
| 106417 | Brenda |
| 71774817 | PubChem |
| MCULE-3226089160 | Mcule |
| MCULE-1814780282 | Mcule |
| SCHEMBL1646 | SureChEMBL |
| 15219170 | PubChem: Thomson Pharma |
| 5962 | PubChem |
| 60018668 | NMRShiftDB |
| PD007146 | ProbesDrugs |
| K3Z4F929H6 | FDA SRS |
| 15321566 | PubChem: Thomson Pharma |
| 25104-18-1 | ACToR |
| 26714-32-9 | ACToR |
| 12798-06-0 | ACToR |
| 280114-50-3 | ACToR |
| 20166-34-1 | ACToR |
| 524855 | eMolecules |
| DB00123 | DrugBank |
| C00047 | KEGG Ligand |
| CHEMBL8085 | ChEMBL |
| 18019 | ChEBI |
| 134287 | Brenda |
| 229583 | Brenda |
| LYSINE | rxnorm |
| LYSINE | clinicaltrials |
| HY-N0469 | MedChemExpress |
| 168007633 | PubChem |
| DTXSID6023232 | EPA CompTox Dashboard |
| 122198194 | PubChem |
| 133538 | ChEBI |
| 1622 | DrugCentral |
| ZINC000001532522 | ZINC |
| 724 | Guide to Pharmacology |
| J9.176F | Nikkaji |
| 194466 | ChEBI |
| CUFFUG | CCDC |
| LYSINE | DailyMed |
| The data in this table is sourced from UniChem at EBI. | |