Dataset
![molecular Image]()
L-Glutamine
Chemical Info
| InChI | InChI=1S/C5H10N2O3/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H2,7,8)(H,9,10)/t3-/m0/s1 |
|---|---|
| SMILES | C(CC(=O)N)[C@@H](C(=O)O)N |
| InChI Key | ZDXPYRJPNDTMRX-VKHMYHEASA-N |
| Molecular Formula | C5H10N2O3 |
| Exact Mass | 146.069 g/mol |
Data and Resources
Metadata Information
| Field | Value |
|---|---|
| DOI | |
| License URL | https://creativecommons.org/licenses/by/4.0 |
| Source | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-Antwerp_Univ-METOX_P100633_9EE2 |
| Version | |
| Author | |
| Maintainer | |
| Language | |
| MetadataCreated | 2024-01-11T09:39:18.387943 |
| MetadataModified | 2025-02-08T18:50:44.642168 |
| MetadataPublished | 2021-12-09 |
| Field | Value |
|---|---|
| Measurement Technique | liquid chromatography-mass spectrometry |
| Measurement Variables |
| Data-Source Molecule ID | Data-Source |
|---|---|
| DB00130 | DrugBank |
| C00064 | KEGG Ligand |
| CHEMBL930 | ChEMBL |
| 58359 | ChEBI |
| 18050 | ChEBI |
| 723 | Guide to Pharmacology |
| 1311 | DrugCentral |
| ZINC000001532526 | ZINC |
| 4633 | Guide to Pharmacology |
| 4634 | Guide to Pharmacology |
| J9.170G | Nikkaji |
| GLUTAM | CCDC |
| 18121 | BindingDB |
| DTXSID1023100 | EPA CompTox Dashboard |
| HY-N0390 | MedChemExpress |
| NUTRESTORE | clinicaltrials |
| ENDARI | clinicaltrials |
| L-GLUTAMINE | clinicaltrials |
| GLUTAMINE | clinicaltrials |
| LEVOGLUTAMIDE | clinicaltrials |
| GLUTAMINE | rxnorm |
| NUTRESTORE | rxnorm |
| ENDARI | rxnorm |
| GLUTAMINE | DailyMed |
| SCHEMBL23141036 | SureChEMBL |
| CB14796928 | ChemicalBook |
| CB34867000 | ChemicalBook |
| 229576 | Brenda |
| GLN | PDBe |
| glutamine | DailyMed |
| CB6280105 | ChemicalBook |
| 58359 | Rhea |
| HMDB0000641 | Human Metabolome Database |
| 755 | Brenda |
| 145942 | Brenda |
| 138052 | Brenda |
| 145028 | Brenda |
| 378 | Brenda |
| 145026 | Brenda |
| 337 | Brenda |
| 69708 | Brenda |
| 36640 | Brenda |
| 102 | Brenda |
| MTBLC58359 | Metabolights |
| MTBLC18050 | Metabolights |
| PA10090 | PharmGKB |
| SCHEMBL7453 | SureChEMBL |
| MCULE-8718820108 | Mcule |
| 60018642 | NMRShiftDB |
| 5961 | PubChem |
| 6992086 | PubChem |
| 15297396 | PubChem: Thomson Pharma |
| Glutamine | Selleck |
| 585-21-7 | ACToR |
| 32640-56-5 | ACToR |
| 26700-71-0 | ACToR |
| gln_L | Recon |
| LSM-4741 | LINCS |
| 0RH81L854J | FDA SRS |
| PD001524 | ProbesDrugs |
| glutamine | Atlas |
| 514487 | eMolecules |
| The data in this table is sourced from UniChem at EBI. | |