Dataset
L-ORNITHINE; LC-ESI-QTOF; MS2; CE: 40eV; R=5000; [M+H]+
Chemical Information
| InChI | InChI=1S/C5H12N2O2/c6-3-1-2-4(7)5(8)9/h4H,1-3,6-7H2,(H,8,9)/t4-/m0/s1 |
|---|---|
| SMILES | NCCC[C@H](N)C(O)=O |
| InChI Key | AHLPHDHHMVZTML-BYPYZUCNSA-N |
| Molecular Formula | C5H12N2O2 |
| Exact Mass | 132.090 g/mol |
Data and Resources
Metadata Information
| Field | Value |
|---|---|
| DOI | |
| License URL | https://creativecommons.org/licenses/by/4.0 |
| Source | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-Antwerp_Univ-METOX_P101001_FB57 |
| Version | |
| Author | |
| Maintainer | |
| Language | |
| MetadataPublished | 2021-12-14 |
| Related Molecule |
|
| Field | Value |
|---|---|
| Measurement Technique | liquid chromatography-mass spectrometry |
| Measurement Variables |
| Data-Source Molecule ID | Data-Source |
|---|---|
| MTBLC15729 | Metabolights |
| 108680 | Brenda |
| 576 | Brenda |
| 98023 | Brenda |
| 192 | Brenda |
| HMDB0000214 | Human Metabolome Database |
| 93763 | Brenda |
| DTXSID00883219 | EPA CompTox Dashboard |
| ornithine | DailyMed |
| 885 | Brenda |
| 3657 | Brenda |
| SCHEMBL8579 | SureChEMBL |
| 25104-12-5 | ACToR |
| 410523-46-5 | ACToR |
| E524N2IXA3 | FDA SRS |
| 60018697 | NMRShiftDB |
| 15119954 | PubChem: Thomson Pharma |
| 6262 | PubChem |
| PD010228 | ProbesDrugs |
| 884260 | eMolecules |
| C00077 | KEGG Ligand |
| DB00129 | DrugBank |
| ORN | PDBe |
| CHEMBL446143 | ChEMBL |
| 15729 | ChEBI |
| 725 | Guide to Pharmacology |
| ORNITHINE, (L)-ISOMER | rxnorm |
| 50487430 | BindingDB |
| OCR-002 | clinicaltrials |
| ORNITHINE OXOGLURATE | clinicaltrials |
| HY-B1352 | MedChemExpress |
| ORNITHINE | clinicaltrials |
| ORNITHINE PHENYLACETATE | clinicaltrials |
| CB3888326 | ChemicalBook |
| MCULE-3029872280 | Mcule |
| 3401 | DrugCentral |
| ZINC000001532530 | ZINC |
| J9.177D | Nikkaji |
| 88747248 | PubChem |
| 229586 | Brenda |
| ORNITHINE | DailyMed |
| ORNITHINE | rxnorm |
| 106425 | Brenda |
| CB2199856 | ChemicalBook |
| 33186 | Brenda |
| PA164783814 | PharmGKB |
| 106426 | Brenda |
| The data in this table is sourced from UniChem at EBI. | |