Dataset
Lorazepam; LC-ESI-QTOF; MS2; CE: 20 eV; R=35000; [M+H]+
Chemical Information
| InChI | InChI=1S/C15H10Cl2N2O2/c16-8-5-6-12-10(7-8)13(19-15(21)14(20)18-12)9-3-1-2-4-11(9)17/h1-7,15,21H,(H,18,20) |
|---|---|
| SMILES | OC1N=C(C2=CC=CC=C2Cl)C2=C(NC1=O)C=CC(Cl)=C2 |
| InChI Key | DIWRORZWFLOCLC-UHFFFAOYSA-N |
| Molecular Formula | C15H10Cl2N2O2 |
| Exact Mass | 320.012 g/mol |
Data and Resources
Metadata Information
| Field | Value |
|---|---|
| DOI | |
| License URL | https://creativecommons.org/licenses/by/4.0 |
| Source | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-Athens_Univ-AU151202 |
| Version | |
| Author | |
| Maintainer | |
| Language | |
| MetadataPublished | 2019-05-30 |
| Related Molecule |
|
| Field | Value |
|---|---|
| Measurement Technique | liquid chromatography-mass spectrometry |
| Measurement Variables |
| Data-Source Molecule ID | Data-Source |
|---|---|
| 50292627 | BindingDB |
| LORAZEPAM | DailyMed |
| ATIVAN | rxnorm |
| LORAZEPAM | rxnorm |
| ATIVAN | clinicaltrials |
| LORAZEPAM | clinicaltrials |
| J3.337E | Nikkaji |
| O26FZP769L | FDA SRS |
| DTXSID7023225 | EPA CompTox Dashboard |
| 6539 | ChEBI |
| 5884 | Guide to Pharmacology |
| WY-4036 | clinicaltrials |
| 1606 | DrugCentral |
| CHEMBL580 | ChEMBL |
| SAM001246833 | NIH Clinical Collection |
| DB00186 | DrugBank |
| HMDB0014332 | Human Metabolome Database |
| lorazepam | DailyMed |
| 8612 | Brenda |
| 3958 | PubChem |
| SCHEMBL26961 | SureChEMBL |
| 14801418 | PubChem: Thomson Pharma |
| 60059404 | NMRShiftDB |
| PD003117 | ProbesDrugs |
| 846-49-1 | ACToR |
| PA450267 | PharmGKB |
| LSM-4970 | LINCS |
| 552192 | eMolecules |
| The data in this table is sourced from UniChem at EBI. | |