Dataset
Dihydrotestosterone; LC-ESI-QTOF; MS2; CE: 10 eV; R=35000; [M+H]+
Chemical Information
| InChI | InChI=1S/C19H30O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h12,14-17,21H,3-11H2,1-2H3/t12-,14-,15-,16-,17-,18-,19-/m0/s1 |
|---|---|
| SMILES | [H][C@@]12CC[C@H](O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC[C@@]2([H])CC(=O)CC[C@]12C |
| InChI Key | NVKAWKQGWWIWPM-ABEVXSGRSA-N |
| Molecular Formula | C19H30O2 |
| Exact Mass | 290.225 g/mol |
Data and Resources
Metadata Information
| Field | Value |
|---|---|
| DOI | |
| License URL | https://creativecommons.org/licenses/by/4.0 |
| Source | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-Athens_Univ-AU280501 |
| Version | |
| Author | |
| Maintainer | |
| Language | |
| MetadataPublished | 2019-05-31 |
| Related Molecule |
|
| Field | Value |
|---|---|
| Measurement Technique | liquid chromatography-mass spectrometry |
| Measurement Variables |
| Data-Source Molecule ID | Data-Source |
|---|---|
| 10635 | PubChem |
| PD012320 | ProbesDrugs |
| 80004316 | NMRShiftDB |
| 08J2K08A3Y | FDA SRS |
| 17beta-hydroxy-5alpha-androstan-3-one | Atlas |
| 14751321 | PubChem: Thomson Pharma |
| 5adtststerone | Recon |
| 12040-51-6 | ACToR |
| SCHEMBL15163 | SureChEMBL |
| 14751322 | PubChem: Thomson Pharma |
| 521-18-6 | ACToR |
| 477779 | eMolecules |
| ZINC000003814360 | ZINC |
| CB9181225 | ChemicalBook |
| 95659 | Brenda |
| 16330 | Rhea |
| 217860 | Brenda |
| 104356 | Brenda |
| HMDB0002961 | Human Metabolome Database |
| 2703 | Brenda |
| 8094 | Brenda |
| 18699 | Brenda |
| 104347 | Brenda |
| 172580 | Brenda |
| 11107 | Brenda |
| 105443 | Brenda |
| 2393 | Brenda |
| MTBLC16330 | Metabolights |
| 737 | Brenda |
| 13107 | Brenda |
| 107938 | Brenda |
| 2055 | Brenda |
| MCULE-5987413622 | Mcule |
| 174924 | Brenda |
| SLM:000001058 | SwissLipids |
| DB02901 | DrugBank |
| DTXSID9022364 | EPA CompTox Dashboard |
| 3927 | DrugCentral |
| LMST02020042 | LipidMaps |
| 2856 | Guide to Pharmacology |
| J39.503J | Nikkaji |
| HANDRO | CCDC |
| 18161 | BindingDB |
| 50366473 | BindingDB |
| 3455 | Guide to Pharmacology |
| C03917 | KEGG Ligand |
| 57304367 | PubChem: Drugs of the Future |
| DHT | PDBe |
| 16330 | ChEBI |
| CHEMBL27769 | ChEMBL |
| The data in this table is sourced from UniChem at EBI. | |