Dataset
Dihydrotestosterone
Chemical Info
InChI | InChI=1S/C19H30O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h12,14-17,21H,3-11H2,1-2H3/t12-,14-,15-,16-,17-,18-,19-/m0/s1 |
---|---|
SMILES | [H][C@@]12CC[C@H](O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC[C@@]2([H])CC(=O)CC[C@]12C |
InChI Key | NVKAWKQGWWIWPM-ABEVXSGRSA-N |
Molecular Formula | C19H30O2 |
Exact Mass | 290.225 g/mol |
Data and Resources
Metadata Information
Field | Value |
---|---|
DOI | |
License URL | |
Source | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-Athens_Univ-AU280506 |
Version | |
Author | |
Maintainer | |
Language | |
MetadataCreated | 2024-01-11T09:50:12.096067 |
MetadataModified | 2024-01-11T09:50:12.259808 |
MetadataPublished | 2019-05-31 |
Field | Value |
---|---|
Measurement Technique | liquid chromatography-mass spectrometry |
Measurement Variables |
Data-Source Molecule ID | Data-Source |
---|---|
10635 | PubChem |
PD012320 | ProbesDrugs |
80004316 | NMRShiftDB |
08J2K08A3Y | FDA SRS |
17beta-hydroxy-5alpha-androstan-3-one | Atlas |
14751321 | PubChem: Thomson Pharma |
5adtststerone | Recon |
12040-51-6 | ACToR |
SCHEMBL15163 | SureChEMBL |
14751322 | PubChem: Thomson Pharma |
521-18-6 | ACToR |
3455 | Guide to Pharmacology |
2856 | Guide to Pharmacology |
MCULE-5987413622 | Mcule |
HANDRO | CCDC |
J39.503J | Nikkaji |
SLM:000001058 | SwissLipids |
CB9181225 | ChemicalBook |
174924 | Brenda |
16330 | Rhea |
105443 | Brenda |
2393 | Brenda |
95659 | Brenda |
104356 | Brenda |
HMDB0002961 | Human Metabolome Database |
13107 | Brenda |
737 | Brenda |
2703 | Brenda |
8094 | Brenda |
18699 | Brenda |
104347 | Brenda |
172580 | Brenda |
11107 | Brenda |
2055 | Brenda |
107938 | Brenda |
MTBLC16330 | Metabolights |
217860 | Brenda |
ZINC000003814360 | ZINC |
LMST02020042 | LipidMaps |
3927 | DrugCentral |
DTXSID9022364 | EPA CompTox Dashboard |
18161 | BindingDB |
50366473 | BindingDB |
DB02901 | DrugBank |
477779 | eMolecules |
CHEMBL27769 | ChEMBL |
57304367 | PubChem: Drugs of the Future |
C03917 | KEGG Ligand |
DHT | PDBe |
16330 | ChEBI |
The data in this table is sourced from UniChem at EBI. |