Dataset
Carbaryl; LC-ESI-QTOF; MS2; 140 V
Chemical Information
| InChI | InChI=1S/C12H11NO2/c1-13-12(14)15-11-8-4-6-9-5-2-3-7-10(9)11/h2-8H,1H3,(H,13,14) |
|---|---|
| SMILES | CNC(=O)Oc1cccc2ccccc12 |
| InChI Key | CVXBEEMKQHEXEN-UHFFFAOYSA-N |
| Molecular Formula | C12H11NO2 |
| Exact Mass | 201.079 g/mol |
Data and Resources
Metadata Information
| Field | Value |
|---|---|
| DOI | |
| License URL | |
| Source | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-BAFG-CSL2311095487 |
| Version | |
| Author | |
| Maintainer | |
| Language | |
| MetadataPublished | 2023-11-09 |
| Related Molecule |
|
| Field | Value |
|---|---|
| Measurement Technique | liquid chromatography-mass spectrometry |
| Measurement Variables |
| Data-Source Molecule ID | Data-Source |
|---|---|
| DB15930 | drugbank |
| CHEBI:3390 | chebi |
| CHEMBL46917 | chembl |
| 26737 | surechembl |
| 29370871 | surechembl |
| 6129 | pubchem |
| R890C8J3N1 | fdasrs |
| PD001177 | probes_and_drugs |
| 139515 | brenda |
| 182794 | brenda |
| 184376 | brenda |
| 1966 | brenda |
| 36931 | brenda |
| 46931 | brenda |
| 76949 | brenda |
| HMDB0249612 | hmdb |
| 3066 | drugcentral |
| 50128572 | bindingdb |
| The data in this table is sourced from UniChem at EBI. | |