Dataset
5-Fluorouracil; LC-ESI-QTOF; MS2; 150 V
Chemical Information
| InChI | InChI=1S/C4H3FN2O2/c5-2-1-6-4(9)7-3(2)8/h1H,(H2,6,7,8,9) |
|---|---|
| SMILES | C1=C(C(=O)NC(=O)N1)F |
| InChI Key | GHASVSINZRGABV-UHFFFAOYSA-N |
| Molecular Formula | C4H3FN2O2 |
| Exact Mass | 130.018 g/mol |
Data and Resources
Metadata Information
| Field | Value |
|---|---|
| DOI | |
| License URL | |
| Source | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-BAFG-CSL23111013647 |
| Version | |
| Author | |
| Maintainer | |
| Language | |
| MetadataPublished | 2023-11-10 |
| Related Molecule |
|
| Field | Value |
|---|---|
| Measurement Technique | liquid chromatography-mass spectrometry |
| Measurement Variables |
| Data-Source Molecule ID | Data-Source |
|---|---|
| DB00544 | DrugBank |
| URF | PDBe |
| SAM002264615 | NIH Clinical Collection |
| C07649 | KEGG Ligand |
| CHEMBL185 | ChEMBL |
| FLUOROURACIL | DailyMed |
| 50340677 | BindingDB |
| 229065 | Brenda |
| EFUDEX | rxnorm |
| FLUOROPLEX | rxnorm |
| CARAC | rxnorm |
| TOLAK | rxnorm |
| FLUOROURACIL | rxnorm |
| ADRUCIL | rxnorm |
| RO-2-9757 | clinicaltrials |
| CARAC | clinicaltrials |
| ADRUCIL | clinicaltrials |
| FLUOROPLEX | clinicaltrials |
| FLUOROURACIL | clinicaltrials |
| EFUDEX | clinicaltrials |
| NSC-19893 | clinicaltrials |
| HY-90006 | MedChemExpress |
| RO 2-9757 | clinicaltrials |
| 26 | DrugCentral |
| 4789 | Guide to Pharmacology |
| J4.489J | Nikkaji |
| FURACL | CCDC |
| 229064 | Brenda |
| HMDB0014684 | Human Metabolome Database |
| DTXSID2020634 | EPA CompTox Dashboard |
| U3P01618RT | FDA SRS |
| 5-fluourouracil | Atlas |
| 5-fluorouracil | Atlas |
| PD002327 | ProbesDrugs |
| LSM-4261 | LINCS |
| 1004-03-1 | ACToR |
| 15218968 | PubChem: Thomson Pharma |
| PA128406956 | PharmGKB |
| Adrucil(Fluorouracil) | Selleck |
| 512920 | eMolecules |
| 13386136 | eMolecules |
| 155282 | Brenda |
| 812 | Brenda |
| fluorouracil | DailyMed |
| 51649 | Brenda |
| ZINC000038212689 | ZINC |
| CB8162744 | ChemicalBook |
| MCULE-6338086431 | Mcule |
| SCHEMBL3646 | SureChEMBL |
| 3385 | PubChem |
| 20027309 | NMRShiftDB |
| 46345 | ChEBI |
| The data in this table is sourced from UniChem at EBI. | |