Dataset
Nifedipine; LC-ESI-QTOF; MS2; 10 V
Chemical Information
| InChI | InChI=1S/C17H18N2O6/c1-9-13(16(20)24-3)15(14(10(2)18-9)17(21)25-4)11-7-5-6-8-12(11)19(22)23/h5-8,15,18H,1-4H3 |
|---|---|
| SMILES | CC1=C(C(C(=C(N1)C)C(=O)OC)C2=CC=CC=C2[N+](=O)[O-])C(=O)OC |
| InChI Key | HYIMSNHJOBLJNT-UHFFFAOYSA-N |
| Molecular Formula | C17H18N2O6 |
| Exact Mass | 346.116 g/mol |
Data and Resources
Metadata Information
| Field | Value |
|---|---|
| DOI | |
| License URL | |
| Source | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-BAFG-CSL23111013717 |
| Version | |
| Author | |
| Maintainer | |
| Language | |
| MetadataPublished | 2023-11-10 |
| Related Molecule |
|
| Field | Value |
|---|---|
| Measurement Technique | liquid chromatography-mass spectrometry |
| Measurement Variables |
| Data-Source Molecule ID | Data-Source |
|---|---|
| 14875984 | PubChem: Thomson Pharma |
| 60021396 | NMRShiftDB |
| PD001839 | ProbesDrugs |
| nifedipine | Atlas |
| I9ZF7L6G2L | FDA SRS |
| nifedipine | Recon |
| 101539-70-2 | ACToR |
| 21829-25-4 | ACToR |
| PA450631 | PharmGKB |
| Nifedipine(Adalat) | Selleck |
| LSM-4176 | LINCS |
| 715726 | eMolecules |
| 132142 | Brenda |
| HMDB0015247 | Human Metabolome Database |
| 125893 | Brenda |
| 3738 | Brenda |
| MTBLC7565 | Metabolights |
| ZINC000085205448 | ZINC |
| nifedipine | DailyMed |
| SCHEMBL3968 | SureChEMBL |
| MCULE-7336870265 | Mcule |
| 4485 | PubChem |
| DB01115 | DrugBank |
| 12014071 | PubChem: Drugs of the Future |
| CHEMBL193 | ChEMBL |
| 2514 | Guide to Pharmacology |
| 7565 | ChEBI |
| C07266 | KEGG Ligand |
| NIFEDIPINE | DailyMed |
| 224433 | Brenda |
| AFEDITAB CR | rxnorm |
| PROCARDIA | rxnorm |
| NIFEDIPINE | rxnorm |
| ADALAT | rxnorm |
| PROCARDIA | clinicaltrials |
| NIFEDIPINE | clinicaltrials |
| AFEDITAB CR | clinicaltrials |
| CORACTEN | clinicaltrials |
| BAY-A-1040 | clinicaltrials |
| BAY A 1040 | clinicaltrials |
| ADALAT | clinicaltrials |
| HY-B0284 | MedChemExpress |
| DTXSID2025715 | EPA CompTox Dashboard |
| 229728 | Brenda |
| 229727 | Brenda |
| 50101817 | BindingDB |
| 1922 | DrugCentral |
| BICCIZ | CCDC |
| 127074 | Brenda |
| C5U | PDBe |
| The data in this table is sourced from UniChem at EBI. | |