Dataset
2-Naphthalenesulfonic acid; LC-ESI-QTOF; MS2; 80 V
Chemical Information
| InChI | InChI=1S/C10H8O3S/c11-14(12,13)10-6-5-8-3-1-2-4-9(8)7-10/h1-7H,(H,11,12,13) |
|---|---|
| SMILES | C1=CC=C2C=C(C=CC2=C1)S(=O)(=O)O |
| InChI Key | KVBGVZZKJNLNJU-UHFFFAOYSA-N |
| Molecular Formula | C10H8O3S |
| Exact Mass | 208.019 g/mol |
Data and Resources
Metadata Information
| Field | Value |
|---|---|
| DOI | |
| License URL | |
| Source | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-BAFG-CSL23111015145 |
| Version | |
| Author | |
| Maintainer | |
| Language | |
| MetadataPublished | 2023-11-10 |
| Related Molecule |
|
| Field | Value |
|---|---|
| Measurement Technique | liquid chromatography-mass spectrometry |
| Measurement Variables |
| Data-Source Molecule ID | Data-Source |
|---|---|
| DB08254 | drugbank |
| NAS | rcsb_pdb |
| CHEMBL1234624 | chembl |
| 1556 | surechembl |
| 29357423 | surechembl |
| 29857297 | surechembl |
| 8420 | pubchem |
| O9S4K2S25E | fdasrs |
| NAS | pdbe |
| PD004600 | probes_and_drugs |
| 104615 | brenda |
| 127468 | brenda |
| 166095 | brenda |
| CHEBI:44229 | chebi |
| HMDB0255446 | hmdb |
| DTXSID5044788 | comptox |
| Molport-000-146-053 | molport |
| The data in this table is sourced from UniChem at EBI. | |