Dataset
2,4-Dichlorophenoxyacetic acid; LC-ESI-QTOF; MS2; 20 V
Chemical Information
| InChI | InChI=1S/C8H6Cl2O3/c9-5-1-2-7(6(10)3-5)13-4-8(11)12/h1-3H,4H2,(H,11,12) |
|---|---|
| SMILES | c1cc(c(cc1Cl)Cl)OCC(=O)O |
| InChI Key | OVSKIKFHRZPJSS-UHFFFAOYSA-N |
| Molecular Formula | C8H6Cl2O3 |
| Exact Mass | 219.969 g/mol |
Data and Resources
Metadata Information
| Field | Value |
|---|---|
| DOI | |
| License URL | |
| Source | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-BAFG-CSL23111017234 |
| Version | |
| Author | |
| Maintainer | |
| Language | |
| MetadataPublished | 2023-11-10 |
| Related Molecule |
|
| Field | Value |
|---|---|
| Measurement Technique | liquid chromatography-mass spectrometry |
| Measurement Variables |
| Data-Source Molecule ID | Data-Source |
|---|---|
| CHEBI:28854 | chebi |
| CFA | rcsb_pdb |
| CHEMBL367623 | chembl |
| 27783 | surechembl |
| 1486 | pubchem |
| 2577AQ9262 | fdasrs |
| PD021395 | probes_and_drugs |
| CPXACA | CCDC |
| 109417 | brenda |
| 114571 | brenda |
| 181844 | brenda |
| 183119 | brenda |
| 184407 | brenda |
| 184408 | brenda |
| 184409 | brenda |
| 184410 | brenda |
| 184411 | brenda |
| 184412 | brenda |
| 184413 | brenda |
| 184414 | brenda |
| 184415 | brenda |
| 184416 | brenda |
| 184417 | brenda |
| 184418 | brenda |
| 184419 | brenda |
| 184420 | brenda |
| 184421 | brenda |
| 184422 | brenda |
| 220382 | brenda |
| 29340 | brenda |
| 44039 | brenda |
| 5092 | brenda |
| CFA | pdbe |
| HMDB0041797 | hmdb |
| DTXSID0020442 | comptox |
| Molport-000-454-068 | molport |
| 50486213 | bindingdb |
| The data in this table is sourced from UniChem at EBI. | |