Dataset
Triamterene; LC-ESI-QTOF; MS2; 90 V
Chemical Information
| InChI | InChI=1S/C12H11N7/c13-9-7(6-4-2-1-3-5-6)16-8-10(14)18-12(15)19-11(8)17-9/h1-5H,(H6,13,14,15,17,18,19) |
|---|---|
| SMILES | C1=CC=C(C=C1)C2=NC3=C(N=C2N)N=C(N=C3N)N |
| InChI Key | FNYLWPVRPXGIIP-UHFFFAOYSA-N |
| Molecular Formula | C12H11N7 |
| Exact Mass | 253.108 g/mol |
Data and Resources
Metadata Information
| Field | Value |
|---|---|
| DOI | |
| License URL | |
| Source | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-BAFG-CSL2311108988 |
| Version | |
| Author | |
| Maintainer | |
| Language | |
| MetadataPublished | 2023-11-10 |
| Related Molecule |
|
| Field | Value |
|---|---|
| Measurement Technique | liquid chromatography-mass spectrometry |
| Measurement Variables |
| Data-Source Molecule ID | Data-Source |
|---|---|
| SAM002554937 | NIH Clinical Collection |
| CHEMBL585 | ChEMBL |
| DX2 | PDBe |
| DB00384 | DrugBank |
| TRIAMTERENE | rxnorm |
| TRIAMTERENE | clinicaltrials |
| HY-B0575 | MedChemExpress |
| DTXSID6021373 | EPA CompTox Dashboard |
| 2728 | DrugCentral |
| 9671 | ChEBI |
| ZINC000000120286 | ZINC |
| 4329 | Guide to Pharmacology |
| J2.040K | Nikkaji |
| FITZAJ | CCDC |
| 6644 | BindingDB |
| TRIAMTERENE | DailyMed |
| DYRENIUM | rxnorm |
| CB0663775 | ChemicalBook |
| triamterene | DailyMed |
| HMDB0001940 | Human Metabolome Database |
| 45956 | Brenda |
| 27748 | Brenda |
| PA451752 | PharmGKB |
| MCULE-5832721534 | Mcule |
| 14774401 | PubChem: Thomson Pharma |
| 5546 | PubChem |
| PD002107 | ProbesDrugs |
| triamterene | Atlas |
| triamterene | Selleck |
| LSM-4060 | LINCS |
| SCHEMBL40707 | SureChEMBL |
| 396-01-0 | ACToR |
| WS821Z52LQ | FDA SRS |
| 594844 | eMolecules |
| The data in this table is sourced from UniChem at EBI. | |