Dataset
Isoquercetin; LC-ESI-QTOF; MS2; CE: 10; R=; [M+H]+
Chemical Information
| InChI | InChI=1S/C21H20O12/c22-6-13-15(27)17(29)18(30)21(32-13)33-20-16(28)14-11(26)4-8(23)5-12(14)31-19(20)7-1-2-9(24)10(25)3-7/h1-5,13,15,17-18,21-27,29-30H,6H2/t13-,15-,17+,18-,21+/m1/s1 |
|---|---|
| SMILES | C1=CC(=C(C=C1C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O)O |
| InChI Key | OVSQVDMCBVZWGM-QSOFNFLRSA-N |
| Molecular Formula | C21H20O12 |
| Exact Mass | 464.096 g/mol |
Data and Resources
Metadata Information
| Field | Value |
|---|---|
| DOI | |
| License URL | https://creativecommons.org/licenses/by/4.0 |
| Source | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-BGC_Munich-RP017101 |
| Version | |
| Author | |
| Maintainer | |
| Language | |
| MetadataPublished | 2017-10-24 |
| Related Molecule |
|
| Field | Value |
|---|---|
| Measurement Technique | liquid chromatography-mass spectrometry |
| Measurement Variables |
| Data-Source Molecule ID | Data-Source |
|---|---|
| CHEMBL250450 | ChEMBL |
| 12015418 | PubChem: Drugs of the Future |
| C05623 | KEGG Ligand |
| SAM001246767 | NIH Clinical Collection |
| HW2 | PDBe |
| 60005881 | NMRShiftDB |
| LMPK12112086 | LipidMaps |
| ISOQUERCETIN | clinicaltrials |
| ISOQUERCITRIN | clinicaltrials |
| 249134 | Brenda |
| 153265 | BindingDB |
| MCULE-2852848721 | Mcule |
| J263.910F | Nikkaji |
| 249131 | Brenda |
| HY-N1445 | MedChemExpress |
| 17635 | Brenda |
| SCHEMBL181306 | SureChEMBL |
| 68352 | ChEBI |
| 66051 | Brenda |
| 5785 | Brenda |
| 56778 | Brenda |
| 60676 | Brenda |
| 66580 | Brenda |
| 4048 | Brenda |
| 15801 | Brenda |
| 4984 | Brenda |
| HMDB0037362 | Human Metabolome Database |
| CB6419347 | ChemicalBook |
| CB9419348 | ChemicalBook |
| ZINC000004096845 | ZINC |
| MTBLC68352 | Metabolights |
| DB12665 | DrugBank |
| 56650 | Brenda |
| 5280804 | PubChem |
| PD002964 | ProbesDrugs |
| 259767 | Brenda |
| 14809282 | PubChem: Thomson Pharma |
| LSM-5818 | LINCS |
| 14858306 | PubChem: Thomson Pharma |
| 6HN2PC637T | FDA SRS |
| 485752 | eMolecules |
| The data in this table is sourced from UniChem at EBI. | |