Dataset
Isoquercetin; LC-ESI-QTOF; MS2; CE: 40; R=; [M-H]-
Chemical Information
| InChI | InChI=1S/C21H20O12/c22-6-13-15(27)17(29)18(30)21(32-13)33-20-16(28)14-11(26)4-8(23)5-12(14)31-19(20)7-1-2-9(24)10(25)3-7/h1-5,13,15,17-18,21-27,29-30H,6H2/t13-,15-,17+,18-,21+/m1/s1 |
|---|---|
| SMILES | C1=CC(=C(C=C1C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O)O |
| InChI Key | OVSQVDMCBVZWGM-QSOFNFLRSA-N |
| Molecular Formula | C21H20O12 |
| Exact Mass | 464.096 g/mol |
Data and Resources
Metadata Information
| Field | Value |
|---|---|
| DOI | |
| License URL | https://creativecommons.org/licenses/by/4.0 |
| Source | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-BGC_Munich-RP017113 |
| Version | |
| Author | |
| Maintainer | |
| Language | |
| MetadataPublished | 2017-11-29 |
| Related Molecule |
|
| Field | Value |
|---|---|
| Measurement Technique | liquid chromatography-mass spectrometry |
| Measurement Variables |
| Data-Source Molecule ID | Data-Source |
|---|---|
| DB12665 | drugbank |
| CHEBI:68352 | chebi |
| LMPK12112086 | lipidmaps |
| HW2 | rcsb_pdb |
| CHEMBL250450 | chembl |
| 181306 | surechembl |
| 29349832 | surechembl |
| 29354754 | surechembl |
| 5280804 | pubchem |
| 6HN2PC637T | fdasrs |
| PD002964 | probes_and_drugs |
| 15801 | brenda |
| 17635 | brenda |
| 249131 | brenda |
| 249134 | brenda |
| 259767 | brenda |
| 4048 | brenda |
| 49388 | brenda |
| 49389 | brenda |
| 4984 | brenda |
| 56650 | brenda |
| 56778 | brenda |
| 5785 | brenda |
| 60676 | brenda |
| 66051 | brenda |
| 66580 | brenda |
| HMDB0037362 | hmdb |
| 294216 | bindingdb |
| 395939 | bindingdb |
| 395959 | bindingdb |
| Molport-001-740-247 | molport |
| The data in this table is sourced from UniChem at EBI. | |