Dataset
a-Linolenic acid (NMR); LC-ESI-QTOF; MS2; CE:30 eV; [M-H]-
Chemical Information
| InChI | InChI=1S/C18H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h3-4,6-7,9-10H,2,5,8,11-17H2,1H3,(H,19,20)/b4-3-,7-6-,10-9- |
|---|---|
| SMILES | OC(CCCCCCC/C=C\C/C=C\C/C=C\CC)=O |
| InChI Key | DTOSIQBPPRVQHS-PDBXOOCHSA-N |
| Molecular Formula | C18H30O2 |
| Exact Mass | 278.225 g/mol |
Data and Resources
Metadata Information
| Field | Value |
|---|---|
| DOI | |
| License URL | https://creativecommons.org/licenses/by-nc-sa/4.0 |
| Source | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-BS-BS001072 |
| Version | |
| Author | |
| Maintainer | |
| Language | |
| MetadataPublished | 2017-12-01 |
| Related Molecule |
|
| Field | Value |
|---|---|
| Measurement Technique | liquid chromatography-mass spectrometry |
| Measurement Variables |
| Data-Source Molecule ID | Data-Source |
|---|---|
| 46114 | Brenda |
| CB9666441 | ChemicalBook |
| J5.773H | Nikkaji |
| 4618 | DrugCentral |
| LMFA01030152 | LipidMaps |
| DTXSID7025506 | EPA CompTox Dashboard |
| LSM-42939 | LINCS |
| HY-N0728 | MedChemExpress |
| LINOLENIC ACID | rxnorm |
| LINOLENATE | rxnorm |
| 228720 | Brenda |
| 50240347 | BindingDB |
| 1049 | Guide to Pharmacology |
| LNL | PDBe |
| C06427 | KEGG Ligand |
| DB00132 | DrugBank |
| CHEMBL8739 | ChEMBL |
| 27432 | ChEBI |
| 6976 | Brenda |
| 5572 | Brenda |
| 90146 | Brenda |
| 42607 | Brenda |
| 1413 | Brenda |
| 2620 | Brenda |
| 101867 | Brenda |
| 66964 | Brenda |
| HMDB0001388 | Human Metabolome Database |
| CB2112323 | ChemicalBook |
| 32469 | Brenda |
| ZINC000003802189 | ZINC |
| PA449384 | PharmGKB |
| MTBLC27432 | Metabolights |
| 4329 | Brenda |
| 43935 | Brenda |
| SCHEMBL15282 | SureChEMBL |
| 0RBV727H71 | FDA SRS |
| PD010226 | ProbesDrugs |
| 60018784 | NMRShiftDB |
| 14750830 | PubChem: Thomson Pharma |
| 5280934 | PubChem |
| 524832 | eMolecules |
| The data in this table is sourced from UniChem at EBI. | |