Dataset
3',4',7-Trihydroxyisoflavone; LC-ESI-QTOF; MS2; CE:30 eV; [M-H]-
Chemical Information
| InChI | InChI=1S/C15H10O5/c16-9-2-3-10-14(6-9)20-7-11(15(10)19)8-1-4-12(17)13(18)5-8/h1-7,16-18H |
|---|---|
| SMILES | C1(=C(C(=C(C(=C1C2=C(OC3=C(C2=O)C(=C(C(=C3[H])O[H])[H])[H])[H])[H])O[H])O[H])[H])[H] |
| InChI Key | DDKGKOOLFLYZDL-UHFFFAOYSA-N |
| Molecular Formula | C15H10O5 |
| Exact Mass | 270.053 g/mol |
Data and Resources
Metadata Information
| Field | Value |
|---|---|
| DOI | |
| License URL | https://creativecommons.org/licenses/by-nc-sa/4.0 |
| Source | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-BS-BS003735 |
| Version | |
| Author | |
| Maintainer | |
| Language | |
| MetadataPublished | 2017-12-01 |
| Related Molecule |
|
| Field | Value |
|---|---|
| Measurement Technique | liquid chromatography-mass spectrometry |
| Measurement Variables |
| Data-Source Molecule ID | Data-Source |
|---|---|
| LMPK12050055 | lipidmaps |
| 47X | rcsb_pdb |
| CHEMBL13486 | chembl |
| 29392289 | surechembl |
| 29482679 | surechembl |
| 29482686 | surechembl |
| 73012 | surechembl |
| 5284648 | pubchem |
| T08Y239E7Y | fdasrs |
| 9985 | gtopdb |
| PD057176 | probes_and_drugs |
| 225164 | brenda |
| 23230 | brenda |
| 56865 | brenda |
| 57807 | brenda |
| 78348 | brenda |
| HMDB0041655 | hmdb |
| 50416207 | bindingdb |
| 50428938 | bindingdb |
| 50428945 | bindingdb |
| 50444624 | bindingdb |
| 50494679 | bindingdb |
| 50494687 | bindingdb |
| 50555470 | bindingdb |
| 50803956 | bindingdb |
| 51064032 | bindingdb |
| Molport-003-850-715 | molport |
| The data in this table is sourced from UniChem at EBI. | |