Dataset
Daidzin
Chemical Info
InChI | InChI=1S/C21H20O9/c22-8-16-18(25)19(26)20(27)21(30-16)29-12-5-6-13-15(7-12)28-9-14(17(13)24)10-1-3-11(23)4-2-10/h1-7,9,16,18-23,25-27H,8H2/t16-,18-,19+,20-,21-/m1/s1 |
---|---|
SMILES | C1=CC(=CC=C1C2=COC3=C(C2=O)C=CC(=C3)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O |
InChI Key | KYQZWONCHDNPDP-QNDFHXLGSA-N |
Molecular Formula | C21H20O9 |
Exact Mass | 416.111 g/mol |
Data and Resources
Metadata Information
Field | Value |
---|---|
DOI | |
License URL | https://creativecommons.org/licenses/by-nc-sa/4.0 |
Source | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-BS-BS003831 |
Version | |
Author | |
Maintainer | |
Language | |
MetadataCreated | 2024-01-11T12:36:07.219749 |
MetadataModified | 2024-01-11T12:36:07.402078 |
MetadataPublished | 2017-12-01 |
Field | Value |
---|---|
Measurement Technique | liquid chromatography-mass spectrometry |
Measurement Variables |
Data-Source Molecule ID | Data-Source |
---|---|
C10216 | KEGG Ligand |
DB02115 | DrugBank |
DZN | PDBe |
CHEMBL486422 | ChEMBL |
496374 | eMolecules |
107971 | PubChem |
14929155 | PubChem: Thomson Pharma |
60022415 | NMRShiftDB |
PD008540 | ProbesDrugs |
15006457 | PubChem: Thomson Pharma |
4R2X91A5M5 | FDA SRS |
SCHEMBL315373 | SureChEMBL |
1329-08-4 | ACToR |
256598 | Brenda |
ZINC000004098610 | ZINC |
11529 | Brenda |
CB8447760 | ChemicalBook |
MolPort-000-002-994 | MolPort |
HMDB0033991 | Human Metabolome Database |
129146 | Brenda |
123722 | Brenda |
MTBLC42202 | Metabolights |
4380 | Brenda |
23180 | Brenda |
34690 | Brenda |
42202 | Rhea |
45451 | Brenda |
48965 | Brenda |
37130 | Brenda |
11121 | Brenda |
J22.589D | Nikkaji |
50409029 | BindingDB |
42202 | ChEBI |
248534 | Brenda |
MCULE-3986261063 | Mcule |
HY-N0018 | MedChemExpress |
LMPK12050013 | LipidMaps |
The data in this table is sourced from UniChem at EBI. |