Dataset
Daidzin; LC-ESI-QTOF; MS2; CE:20 eV; [M-H]-
Chemical Information
| InChI | InChI=1S/C21H20O9/c22-8-16-18(25)19(26)20(27)21(30-16)29-12-5-6-13-15(7-12)28-9-14(17(13)24)10-1-3-11(23)4-2-10/h1-7,9,16,18-23,25-27H,8H2/t16-,18-,19+,20-,21-/m1/s1 |
|---|---|
| SMILES | C1=CC(=CC=C1C2=COC3=C(C2=O)C=CC(=C3)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O |
| InChI Key | KYQZWONCHDNPDP-QNDFHXLGSA-N |
| Molecular Formula | C21H20O9 |
| Exact Mass | 416.111 g/mol |
Data and Resources
Metadata Information
| Field | Value |
|---|---|
| DOI | |
| License URL | https://creativecommons.org/licenses/by-nc-sa/4.0 |
| Source | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-BS-BS003833 |
| Version | |
| Author | |
| Maintainer | |
| Language | |
| MetadataPublished | 2017-12-01 |
| Related Molecule |
|
| Field | Value |
|---|---|
| Measurement Technique | liquid chromatography-mass spectrometry |
| Measurement Variables |
| Data-Source Molecule ID | Data-Source |
|---|---|
| C10216 | KEGG Ligand |
| DB02115 | DrugBank |
| DZN | PDBe |
| CHEMBL486422 | ChEMBL |
| HY-N0018 | MedChemExpress |
| LMPK12050013 | LipidMaps |
| 248534 | Brenda |
| 50409029 | BindingDB |
| J22.589D | Nikkaji |
| MCULE-3986261063 | Mcule |
| 129146 | Brenda |
| ZINC000004098610 | ZINC |
| 4R2X91A5M5 | FDA SRS |
| 256598 | Brenda |
| 107971 | PubChem |
| 14929155 | PubChem: Thomson Pharma |
| SCHEMBL315373 | SureChEMBL |
| PD008540 | ProbesDrugs |
| 60022415 | NMRShiftDB |
| 15006457 | PubChem: Thomson Pharma |
| 1329-08-4 | ACToR |
| 496374 | eMolecules |
| 42202 | ChEBI |
| 48965 | Brenda |
| 11529 | Brenda |
| 11121 | Brenda |
| 123722 | Brenda |
| 37130 | Brenda |
| HMDB0033991 | Human Metabolome Database |
| 42202 | Rhea |
| CB8447760 | ChemicalBook |
| 23180 | Brenda |
| 45451 | Brenda |
| 34690 | Brenda |
| 4380 | Brenda |
| MTBLC42202 | Metabolights |
| The data in this table is sourced from UniChem at EBI. | |