Dataset
Daidzin; LC-ESI-QTOF; MS2; CE:20 eV; [M-H]-
Chemical Information
| InChI | InChI=1S/C21H20O9/c22-8-16-18(25)19(26)20(27)21(30-16)29-12-5-6-13-15(7-12)28-9-14(17(13)24)10-1-3-11(23)4-2-10/h1-7,9,16,18-23,25-27H,8H2/t16-,18-,19+,20-,21-/m1/s1 |
|---|---|
| SMILES | C1=CC(=CC=C1C2=COC3=C(C2=O)C=CC(=C3)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O |
| InChI Key | KYQZWONCHDNPDP-QNDFHXLGSA-N |
| Molecular Formula | C21H20O9 |
| Exact Mass | 416.111 g/mol |
Data and Resources
Metadata Information
| Field | Value |
|---|---|
| DOI | |
| License URL | https://creativecommons.org/licenses/by-nc-sa/4.0 |
| Source | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-BS-BS003833 |
| Version | |
| Author | |
| Maintainer | |
| Language | |
| MetadataPublished | 2017-12-01 |
| Related Molecule |
|
| Field | Value |
|---|---|
| Measurement Technique | liquid chromatography-mass spectrometry |
| Measurement Variables |
| Data-Source Molecule ID | Data-Source |
|---|---|
| DB02115 | drugbank |
| LMPK12050013 | lipidmaps |
| DZN | rcsb_pdb |
| CHEMBL486422 | chembl |
| 30600131 | surechembl |
| 315373 | surechembl |
| 107971 | pubchem |
| 4R2X91A5M5 | fdasrs |
| CHEBI:42202 | rhea |
| PD008540 | probes_and_drugs |
| 11121 | brenda |
| 11529 | brenda |
| 123332 | brenda |
| 123721 | brenda |
| 123722 | brenda |
| 129146 | brenda |
| 183963 | brenda |
| 23180 | brenda |
| 248534 | brenda |
| 256598 | brenda |
| 34690 | brenda |
| 37130 | brenda |
| 4380 | brenda |
| 45451 | brenda |
| 48965 | brenda |
| HMDB0033991 | hmdb |
| Molport-000-002-994 | molport |
| 50409029 | bindingdb |
| The data in this table is sourced from UniChem at EBI. | |