Dataset
y-Linolenic acid; LC-ESI-QTOF; MS2; CE:30 eV; [M-H]-
Chemical Information
| InChI | InChI=1S/C18H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h6-7,9-10,12-13H,2-5,8,11,14-17H2,1H3,(H,19,20)/b7-6-,10-9-,13-12- |
|---|---|
| SMILES | C(C(C(C(C(/C(=C(\C(/C(=C(\C(/C(=C(\C(C(C(C(C(=O)O[H])([H])[H])([H])[H])([H])[H])([H])[H])/[H])/[H])([H])[H])/[H])/[H])([H])[H])/[H])/[H])([H])[H])([H])[H])([H])[H])([H])[H])([H])([H])[H] |
| InChI Key | VZCCETWTMQHEPK-QNEBEIHSSA-N |
| Molecular Formula | C18H30O2 |
| Exact Mass | 278.225 g/mol |
Data and Resources
Metadata Information
| Field | Value |
|---|---|
| DOI | |
| License URL | https://creativecommons.org/licenses/by-nc-sa/4.0 |
| Source | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-BS-BS003974 |
| Version | |
| Author | |
| Maintainer | |
| Language | |
| MetadataPublished | 2017-12-01 |
| Related Molecule |
|
| Field | Value |
|---|---|
| Measurement Technique | liquid chromatography-mass spectrometry |
| Measurement Variables |
| Data-Source Molecule ID | Data-Source |
|---|---|
| DB13854 | drugbank |
| CHEBI:28661 | chebi |
| LMFA01030141 | lipidmaps |
| CHEMBL464982 | chembl |
| 19418 | surechembl |
| 5280933 | pubchem |
| 78YC2MAX4O | fdasrs |
| PD014105 | probes_and_drugs |
| 108552 | brenda |
| 115713 | brenda |
| 126387 | brenda |
| 136297 | brenda |
| 152071 | brenda |
| 182806 | brenda |
| 182932 | brenda |
| 202736 | brenda |
| 21743 | brenda |
| 228704 | brenda |
| 3746 | brenda |
| 42608 | brenda |
| 48190 | brenda |
| 78714 | brenda |
| HMDB0003073 | hmdb |
| Molport-003-937-818 | molport |
| 1276 | drugcentral |
| 50269532 | bindingdb |
| The data in this table is sourced from UniChem at EBI. | |