Dataset
Rosuvastatin; LC-ESI-ITFT; MS2; CE: 30%; R=15000; [M+H]+
Chemical Information
| InChI | InChI=1S/C22H28FN3O6S/c1-13(2)20-18(10-9-16(27)11-17(28)12-19(29)30)21(14-5-7-15(23)8-6-14)25-22(24-20)26(3)33(4,31)32/h5-10,13,16-17,27-28H,11-12H2,1-4H3,(H,29,30)/b10-9+/t16-,17-/m1/s1 |
|---|---|
| SMILES | CC(C)C1=NC(=NC(=C1/C=C/[C@H](C[C@H](CC(=O)O)O)O)C2=CC=C(C=C2)F)N(C)S(=O)(=O)C |
| InChI Key | BPRHUIZQVSMCRT-VEUZHWNKSA-N |
| Molecular Formula | C22H28FN3O6S |
| Exact Mass | 481.168 g/mol |
Data and Resources
Metadata Information
| Field | Value |
|---|---|
| DOI | |
| License URL | https://creativecommons.org/licenses/by/4.0 |
| Source | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-Eawag-EA280209 |
| Version | |
| Author | |
| Maintainer | |
| Language | |
| MetadataPublished | 2014-01-14 |
| Related Molecule |
|
| Field | Value |
|---|---|
| Measurement Technique | liquid chromatography-mass spectrometry |
| Measurement Variables |
| Data-Source Molecule ID | Data-Source |
|---|---|
| DB01098 | drugbank |
| CHEBI:38545 | chebi |
| CHEMBL1496 | chembl |
| 2520 | surechembl |
| 29722976 | surechembl |
| 446157 | pubchem |
| 413KH5ZJ73 | fdasrs |
| PD009808 | probes_and_drugs |
| 229904 | brenda |
| 229905 | brenda |
| 8562 | brenda |
| HMDB0015230 | hmdb |
| 188968 | bindingdb |
| 188969 | bindingdb |
| 319516 | bindingdb |
| 32851 | bindingdb |
| 32906 | bindingdb |
| 37437 | bindingdb |
| 40110 | bindingdb |
| 50105998 | bindingdb |
| 50408631 | bindingdb |
| 50500126 | bindingdb |
| 50500127 | bindingdb |
| 50500128 | bindingdb |
| 50503590 | bindingdb |
| 50645032 | bindingdb |
| 50825072 | bindingdb |
| Molport-000-883-884 | molport |
| 2406 | drugcentral |
| The data in this table is sourced from UniChem at EBI. | |