Dataset
5-Fluorocytosine; LC-ESI-QFT; MS2; CE: 180%; R=17500; [M+H]+
Chemical Information
| InChI | InChI=1S/C4H4FN3O/c5-2-1-7-4(9)8-3(2)6/h1H,(H3,6,7,8,9) |
|---|---|
| SMILES | C1=NC(=O)NC(=C1F)N |
| InChI Key | XRECTZIEBJDKEO-UHFFFAOYSA-N |
| Molecular Formula | C4H4FN3O |
| Exact Mass | 129.034 g/mol |
Data and Resources
Metadata Information
| Field | Value |
|---|---|
| DOI | |
| License URL | https://creativecommons.org/licenses/by-sa/4.0 |
| Source | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-Eawag-EQ00312109 |
| Version | |
| Author | |
| Maintainer | |
| Language | |
| MetadataPublished | 2024-05-08 |
| Related Molecule |
|
| Field | Value |
|---|---|
| Measurement Technique | liquid chromatography-mass spectrometry |
| Measurement Variables |
| Data-Source Molecule ID | Data-Source |
|---|---|
| MEBQEQ | CCDC |
| J3.695A | Nikkaji |
| 1188 | DrugCentral |
| DTXSID3023059 | EPA CompTox Dashboard |
| HY-B0139 | MedChemExpress |
| FLUCYTOSINE | clinicaltrials |
| RO-2-9915 | clinicaltrials |
| RO 2-9915 | clinicaltrials |
| ANCOBON | clinicaltrials |
| 50248003 | BindingDB |
| FLUCYTOSINE | rxnorm |
| ANCOBON | rxnorm |
| FLUCYTOSINE | DailyMed |
| CHEMBL1463 | ChEMBL |
| SAM001246753 | NIH Clinical Collection |
| 5100 | ChEBI |
| DB01099 | DrugBank |
| CB6744939 | ChemicalBook |
| ZINC000000896546 | ZINC |
| flucytosine | DailyMed |
| 1252 | Brenda |
| HMDB0015231 | Human Metabolome Database |
| 3366 | PubChem |
| MCULE-7094058995 | Mcule |
| 1LD | PDBe |
| SCHEMBL24063 | SureChEMBL |
| PD000417 | ProbesDrugs |
| 163444972 | PubChem: Thomson Pharma |
| 14747633 | PubChem: Thomson Pharma |
| Flucytosine(Ancobon) | Selleck |
| PA449654 | PharmGKB |
| 15194483 | PubChem: Thomson Pharma |
| 2022-85-7 | ACToR |
| LSM-5878 | LINCS |
| D83282DT06 | FDA SRS |
| 736052 | eMolecules |
| 538448 | eMolecules |
| 914155 | eMolecules |
| 511893 | eMolecules |
| The data in this table is sourced from UniChem at EBI. | |