Dataset
Paraoxon-ethyl; LC-ESI-QFT; MS2; CE: 60%; R=17500; [M+H]+
Chemical Information
| InChI | InChI=1S/C10H14NO6P/c1-3-15-18(14,16-4-2)17-10-7-5-9(6-8-10)11(12)13/h5-8H,3-4H2,1-2H3 |
|---|---|
| SMILES | CCOP(=O)(OCC)OC1=CC=C(C=C1)[N+](=O)[O-] |
| InChI Key | WYMSBXTXOHUIGT-UHFFFAOYSA-N |
| Molecular Formula | C10H14NO6P |
| Exact Mass | 275.056 g/mol |
Data and Resources
Metadata Information
| Field | Value |
|---|---|
| DOI | |
| License URL | https://creativecommons.org/licenses/by-sa/4.0 |
| Source | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-Eawag-EQ01129004 |
| Version | |
| Author | |
| Maintainer | |
| Language | |
| MetadataPublished | 2023-04-27 |
| Related Molecule |
|
| Field | Value |
|---|---|
| Measurement Technique | liquid chromatography-mass spectrometry |
| Measurement Variables |
| Data-Source Molecule ID | Data-Source |
|---|---|
| DB13495 | drugbank |
| CHEBI:27827 | chebi |
| CHEMBL23838 | chembl |
| 26405 | surechembl |
| 9395 | pubchem |
| Q9CX8P80JW | fdasrs |
| PD071962 | probes_and_drugs |
| 103876 | brenda |
| 106987 | brenda |
| 112667 | brenda |
| 117561 | brenda |
| 12172 | brenda |
| 129658 | brenda |
| 148099 | brenda |
| 163614 | brenda |
| 1644 | brenda |
| 177500 | brenda |
| 178228 | brenda |
| 17929 | brenda |
| 183069 | brenda |
| 197740 | brenda |
| 20240 | brenda |
| 21303 | brenda |
| 228 | brenda |
| 230566 | brenda |
| 232602 | brenda |
| 234393 | brenda |
| 234431 | brenda |
| 27606 | brenda |
| 35441 | brenda |
| 5352 | brenda |
| 53873 | brenda |
| 58859 | brenda |
| 9149 | brenda |
| 93181 | brenda |
| 94511 | brenda |
| 97353 | brenda |
| HMDB0013035 | hmdb |
| Molport-001-783-414 | molport |
| 4683 | drugcentral |
| 50240416 | bindingdb |
| The data in this table is sourced from UniChem at EBI. | |