Dataset
Sucrose; GC-EI-TOF; MS; 8 TMS; BP:103
Chemical Information
| InChI | InChI=1S/C12H22O11/c13-1-4-6(16)8(18)9(19)11(21-4)23-12(3-15)10(20)7(17)5(2-14)22-12/h4-11,13-20H,1-3H2/t4-,5-,6-,7-,8+,9-,10+,11-,12+/m1/s1 |
|---|---|
| SMILES | OC[C@@H](O1)[C@@H](O)[C@H](O)[C@@H](O)[C@H]1O[C@](CO)(O2)[C@@H](O)[C@H](O)[C@@H](CO)2 |
| InChI Key | CZMRCDWAGMRECN-UGDNZRGBSA-N |
| Molecular Formula | C12H22O11 |
| Exact Mass | 342.116 g/mol |
Data and Resources
Metadata Information
| Field | Value |
|---|---|
| DOI | |
| License URL | https://creativecommons.org/licenses/by-sa/4.0 |
| Source | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-Kazusa-KZ000075 |
| Version | |
| Author | |
| Maintainer | |
| Language | |
| MetadataPublished | 2016-01-19 |
| Related Molecule |
|
| Field | Value |
|---|---|
| Measurement Technique | liquid chromatography-mass spectrometry |
| Measurement Variables |
| Data-Source Molecule ID | Data-Source |
|---|---|
| C00089 | KEGG Ligand |
| CHEMBL253582 | ChEMBL |
| 17992 | ChEBI |
| 50108105 | BindingDB |
| SUCROSE | rxnorm |
| SUCROSE SYRUP | rxnorm |
| SUCROSE | clinicaltrials |
| HY-B1779 | MedChemExpress |
| SUCROSE | DailyMed |
| DTXSID2021288 | EPA CompTox Dashboard |
| 4610 | DrugCentral |
| 5411 | Guide to Pharmacology |
| J4.581K | Nikkaji |
| MELKIA | CCDC |
| MCULE-5933491732 | Mcule |
| SCHEMBL1005 | SureChEMBL |
| PA451525 | PharmGKB |
| HMDB0000258 | Human Metabolome Database |
| 47829 | Brenda |
| 124788 | Brenda |
| 152650 | Brenda |
| MTBLC17992 | Metabolights |
| 211271 | Brenda |
| 15973 | Brenda |
| 31914 | Brenda |
| 20931 | Brenda |
| 75951 | Brenda |
| 55 | Brenda |
| ZINC000004217475 | ZINC |
| DB02772 | DrugBank |
| 212424 | Brenda |
| sucrose | DailyMed |
| 17992 | Rhea |
| CB4337508 | ChemicalBook |
| 14778069 | PubChem: Thomson Pharma |
| 5988 | PubChem |
| 60018649 | NMRShiftDB |
| PD046201 | ProbesDrugs |
| C151H8M554 | FDA SRS |
| 14851568 | PubChem: Thomson Pharma |
| sucr | Recon |
| 100405-08-1 | ACToR |
| 8027-47-2 | ACToR |
| 25702-74-3 | ACToR |
| 12040-73-2 | ACToR |
| sucrose | Atlas |
| 29491181 | eMolecules |
| 28206724 | eMolecules |
| 484277 | eMolecules |
| 31265981 | eMolecules |
| The data in this table is sourced from UniChem at EBI. | |