Dataset
Glycyrrhizin; LC-ESI-QQ; MS2; CE:40 V; [M-H]-
Chemical Information
| InChI | InChI=1S/C42H62O16/c1-37(2)21-8-11-42(7)31(20(43)16-18-19-17-39(4,36(53)54)13-12-38(19,3)14-15-41(18,42)6)40(21,5)10-9-22(37)55-35-30(26(47)25(46)29(57-35)33(51)52)58-34-27(48)23(44)24(45)28(56-34)32(49)50/h16,19,21-31,34-35,44-48H,8-15,17H2,1-7H3,(H,49,50)(H,51,52)(H,53,54)/t19-,21-,22-,23-,24-,25-,26-,27+,28-,29-,30+,31+,34-,35-,38+,39-,40-,41+,42+/m0/s1 |
|---|---|
| SMILES | OC(=O)C(C)(C7)CC(C(C)(C7)1)(C(=C6)C(C)(C(C5([H])C6=O)(CCC([H])(C25C)C(C)(C)C(OC(O3)C(OC(O4)C(O)C(C(C4C(O)=O)O)O)C(C(C3C(O)=O)O)O)CC2)C)CC1)[H] |
| InChI Key | LPLVUJXQOOQHMX-QWBHMCJMSA-N |
| Molecular Formula | C42H62O16 |
| Exact Mass | 822.404 g/mol |
Data and Resources
Metadata Information
| Field | Value |
|---|---|
| DOI | |
| License URL | https://creativecommons.org/licenses/by-nc-sa/4.0 |
| Source | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-Keio_Univ-KO000901 |
| Version | |
| Author | |
| Maintainer | |
| Language | |
| MetadataPublished | 2016-01-19 |
| Related Molecule |
|
| Field | Value |
|---|---|
| Measurement Technique | liquid chromatography-mass spectrometry |
| Measurement Variables |
| Data-Source Molecule ID | Data-Source |
|---|---|
| DB13751 | drugbank |
| CHEBI:15939 | chebi |
| CHEMBL441687 | chembl |
| 17684 | surechembl |
| 14982 | pubchem |
| 6FO62043WK | fdasrs |
| PD014506 | probes_and_drugs |
| 15365 | brenda |
| 179224 | brenda |
| 45060 | brenda |
| 4646 | brenda |
| 5309 | brenda |
| 7205 | brenda |
| 50852766 | bindingdb |
| 50911334 | bindingdb |
| 50911337 | bindingdb |
| 51034173 | bindingdb |
| 51036276 | bindingdb |
| 51036279 | bindingdb |
| 51036280 | bindingdb |
| 51036281 | bindingdb |
| 51038683 | bindingdb |
| 51038684 | bindingdb |
| 51038685 | bindingdb |
| 51039165 | bindingdb |
| 51180519 | bindingdb |
| 51180524 | bindingdb |
| 51180789 | bindingdb |
| 51180790 | bindingdb |
| 51180791 | bindingdb |
| 51336634 | bindingdb |
| 51336737 | bindingdb |
| 51423322 | bindingdb |
| Molport-006-113-280 | molport |
| 1325 | drugcentral |
| The data in this table is sourced from UniChem at EBI. | |