Dataset
L-Tyrosine; LC-ESI-QQ; MS2; CE:10 V; [M+H]+
Chemical Information
| InChI | InChI=1S/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13)/t8-/m0/s1 |
|---|---|
| SMILES | OC(=O)C(N)Cc(c1)ccc(O)c1 |
| InChI Key | OUYCCCASQSFEME-QMMMGPOBSA-N |
| Molecular Formula | C9H11NO3 |
| Exact Mass | 181.074 g/mol |
Data and Resources
Metadata Information
| Field | Value |
|---|---|
| DOI | |
| License URL | https://creativecommons.org/licenses/by-nc-sa/4.0 |
| Source | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-Keio_Univ-KO004067 |
| Version | |
| Author | |
| Maintainer | |
| Language | |
| MetadataPublished | 2016-01-19 |
| Related Molecule |
|
| Field | Value |
|---|---|
| Measurement Technique | liquid chromatography-mass spectrometry |
| Measurement Variables |
| Data-Source Molecule ID | Data-Source |
|---|---|
| 6942100 | PubChem |
| 60018698 | NMRShiftDB |
| PD007194 | ProbesDrugs |
| 42HK56048U | FDA SRS |
| 15147336 | PubChem: Thomson Pharma |
| 140-43-2 | ACToR |
| 25619-78-7 | ACToR |
| tyr_L | Recon |
| 514474 | eMolecules |
| 26757083 | eMolecules |
| tyrosine | DailyMed |
| CB1269334 | ChemicalBook |
| 58315 | Rhea |
| HMDB0000158 | Human Metabolome Database |
| 109 | Brenda |
| 618 | Brenda |
| 47528 | Brenda |
| 30315 | Brenda |
| 415 | Brenda |
| 20761 | Brenda |
| 45800 | Brenda |
| 709 | Brenda |
| MTBLC58315 | Metabolights |
| MTBLC17895 | Metabolights |
| PA451822 | PharmGKB |
| MCULE-8059108702 | Mcule |
| 6057 | PubChem |
| MCULE-2932088896 | Mcule |
| SCHEMBL1581 | SureChEMBL |
| DB00135 | DrugBank |
| C00082 | KEGG Ligand |
| CHEMBL925 | ChEMBL |
| 58315 | ChEBI |
| 17895 | ChEBI |
| TYR | PDBe |
| 15195185 | PubChem: Thomson Pharma |
| TYROSINE | DailyMed |
| 229017 | Brenda |
| TYROSINE | rxnorm |
| L-TYROSINE | clinicaltrials |
| TYROSINE | clinicaltrials |
| CB41381672 | ChemicalBook |
| HY-N0473 | MedChemExpress |
| 233214 | Brenda |
| DTXSID1023730 | EPA CompTox Dashboard |
| 2786 | DrugCentral |
| ZINC000000266964 | ZINC |
| 4791 | Guide to Pharmacology |
| J9.173A | Nikkaji |
| LTYROS | CCDC |
| 18129 | BindingDB |
| The data in this table is sourced from UniChem at EBI. | |