Dataset
Colchicine; LC-ESI-ITFT; MS2; CE: 20%; R=15000; [M+H]+
Chemical Information
| InChI | InChI=1S/C22H25NO6/c1-12(24)23-16-8-6-13-10-19(27-3)21(28-4)22(29-5)20(13)14-7-9-18(26-2)17(25)11-15(14)16/h7,9-11,16H,6,8H2,1-5H3,(H,23,24)/t16-/m0/s1 |
|---|---|
| SMILES | CC(=O)N[C@H]1CCC2=CC(=C(C(=C2C3=CC=C(C(=O)C=C13)OC)OC)OC)OC |
| InChI Key | IAKHMKGGTNLKSZ-INIZCTEOSA-N |
| Molecular Formula | C22H25NO6 |
| Exact Mass | 399.168 g/mol |
Data and Resources
Metadata Information
| Field | Value |
|---|---|
| DOI | |
| License URL | |
| Source | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-NaToxAq-NA002292 |
| Version | |
| Author | |
| Maintainer | |
| Language | |
| MetadataPublished | 2020-02-21 |
| Related Molecule |
|
| Field | Value |
|---|---|
| Measurement Technique | liquid chromatography-mass spectrometry |
| Measurement Variables |
| Data-Source Molecule ID | Data-Source |
|---|---|
| 2367 | Guide to Pharmacology |
| 27882 | ChEBI |
| LOC | PDBe |
| 12012587 | PubChem: Drugs of the Future |
| DB01394 | DrugBank |
| C07592 | KEGG Ligand |
| CHEMBL107 | ChEMBL |
| J9.267C | Nikkaji |
| COLCDH | CCDC |
| 50014846 | BindingDB |
| COLCHICINE | DailyMed |
| 229302 | Brenda |
| 229303 | Brenda |
| GLOPERBA | rxnorm |
| MITIGARE | rxnorm |
| COLCRYS | rxnorm |
| COLCHICINE | rxnorm |
| COLCRYS | clinicaltrials |
| COLCHICINE | clinicaltrials |
| HY-16569 | MedChemExpress |
| MCULE-7858118731 | Mcule |
| DTXSID5024845 | EPA CompTox Dashboard |
| 60000009 | NMRShiftDB |
| 726 | DrugCentral |
| ZINC000000621853 | ZINC |
| PA449092 | PharmGKB |
| 30512-31-3 | ACToR |
| SCHEMBL8469 | SureChEMBL |
| LSM-5199 | LINCS |
| PD002408 | ProbesDrugs |
| SML2Y3J35T | FDA SRS |
| colchicine | Atlas |
| 14756995 | PubChem: Thomson Pharma |
| GLOPERBA | clinicaltrials |
| 493998 | eMolecules |
| 6167 | PubChem |
| MCULE-1568647156 | Mcule |
| MTBLC27882 | Metabolights |
| 48923 | Brenda |
| 8394 | Brenda |
| 3334 | Brenda |
| colchicine | DailyMed |
| CB6391144 | ChemicalBook |
| The data in this table is sourced from UniChem at EBI. | |