Dataset
Genistein; LC-APPI-QQ; MS2; CE:20 V; [M+H]+
Chemical Information
| InChI | InChI=1S/C15H10O5/c16-9-3-1-8(2-4-9)11-7-20-13-6-10(17)5-12(18)14(13)15(11)19/h1-7,16-18H |
|---|---|
| SMILES | Oc(c3)ccc(c3)C(=C1)C(=O)c(c(O)2)c(cc(O)c2)O1 |
| InChI Key | TZBJGXHYKVUXJN-UHFFFAOYSA-N |
| Molecular Formula | C15H10O5 |
| Exact Mass | 270.053 g/mol |
Data and Resources
Metadata Information
| Field | Value |
|---|---|
| DOI | |
| License URL | https://creativecommons.org/licenses/by-sa/4.0 |
| Source | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-PFOS_research_group-FFF00197 |
| Version | |
| Author | |
| Maintainer | |
| Language | |
| MetadataPublished | 2016-01-19 |
| Related Molecule |
|
| Field | Value |
|---|---|
| Measurement Technique | liquid chromatography-mass spectrometry |
| Measurement Variables |
| Data-Source Molecule ID | Data-Source |
|---|---|
| DB01645 | drugbank |
| CHEBI:28088 | chebi |
| LMPK12050218 | lipidmaps |
| GEN | rcsb_pdb |
| CHEMBL44 | chembl |
| 19166 | surechembl |
| 29352944 | surechembl |
| 5280961 | pubchem |
| DH2M523P0H | fdasrs |
| GEN | pdbe |
| 2826 | gtopdb |
| PD002146 | probes_and_drugs |
| GENIST | CCDC |
| 164054 | brenda |
| 182914 | brenda |
| 182915 | brenda |
| 182916 | brenda |
| 182917 | brenda |
| 182918 | brenda |
| 229472 | brenda |
| 229473 | brenda |
| 27105 | brenda |
| 377 | brenda |
| 43512 | brenda |
| 56864 | brenda |
| HMDB0003217 | hmdb |
| DTXSID5022308 | comptox |
| NCT00000613 | clinicaltrials |
| NCT00001696 | clinicaltrials |
| NCT00005827 | clinicaltrials |
| NCT00010686 | clinicaltrials |
| NCT00016744 | clinicaltrials |
| NCT00058266 | clinicaltrials |
| NCT00099008 | clinicaltrials |
| NCT00118040 | clinicaltrials |
| NCT00244907 | clinicaltrials |
| NCT00244933 | clinicaltrials |
| NCT00276835 | clinicaltrials |
| NCT00287690 | clinicaltrials |
| NCT00290758 | clinicaltrials |
| NCT00355953 | clinicaltrials |
| NCT00376948 | clinicaltrials |
| NCT00504335 | clinicaltrials |
| NCT00541710 | clinicaltrials |
| NCT00546039 | clinicaltrials |
| NCT00584532 | clinicaltrials |
| NCT00590538 | clinicaltrials |
| NCT00769990 | clinicaltrials |
| NCT00882765 | clinicaltrials |
| NCT01126879 | clinicaltrials |
| NCT01325311 | clinicaltrials |
| NCT01489813 | clinicaltrials |
| NCT01497977 | clinicaltrials |
| NCT01628471 | clinicaltrials |
| NCT01664650 | clinicaltrials |
| NCT01985763 | clinicaltrials |
| NCT02567799 | clinicaltrials |
| NCT02624388 | clinicaltrials |
| NCT02766478 | clinicaltrials |
| NCT02796794 | clinicaltrials |
| NCT03040531 | clinicaltrials |
| NCT04482595 | clinicaltrials |
| NCT04650555 | clinicaltrials |
| Molport-000-003-911 | molport |
| 19459 | bindingdb |
| The data in this table is sourced from UniChem at EBI. | |