Dataset
2'-Deoxyadenosine 5'-monophosphate; LC-ESI-QTOF; MS2; CE:30 V; [M+H]+
Chemical Information
| InChI | InChI=1S/C10H14N5O6P/c11-9-8-10(13-3-12-9)15(4-14-8)7-1-5(16)6(21-7)2-20-22(17,18)19/h3-7,16H,1-2H2,(H2,11,12,13)(H2,17,18,19)/t5-,6+,7+/m0/s1 |
|---|---|
| SMILES | O[C@@H](C1)[C@@H](COP(O)(O)=O)O[C@H]1n(c3)c(n2)c(n3)c(N)nc2 |
| InChI Key | KHWCHTKSEGGWEX-RRKCRQDMSA-N |
| Molecular Formula | C10H14N5O6P |
| Exact Mass | 331.068 g/mol |
Data and Resources
Metadata Information
| Field | Value |
|---|---|
| DOI | |
| License URL | https://creativecommons.org/licenses/by-sa/4.0 |
| Source | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-RIKEN-PR100084 |
| Version | |
| Author | |
| Maintainer | |
| Language | |
| MetadataPublished | 2016-01-19 |
| Related Molecule |
|
| Field | Value |
|---|---|
| Measurement Technique | liquid chromatography-mass spectrometry |
| Measurement Variables |
| Data-Source Molecule ID | Data-Source |
|---|---|
| CHEBI:17713 | chebi |
| D5M | rcsb_pdb |
| DA | rcsb_pdb |
| CHEMBL1206239 | chembl |
| 48174 | surechembl |
| 12599 | pubchem |
| VFR8I97ORM | fdasrs |
| PD018458 | probes_and_drugs |
| 101842 | brenda |
| 105885 | brenda |
| 12291 | brenda |
| 135912 | brenda |
| 145790 | brenda |
| 1745 | brenda |
| 176385 | brenda |
| 176386 | brenda |
| 176472 | brenda |
| 179992 | brenda |
| 182179 | brenda |
| 189738 | brenda |
| 29317 | brenda |
| 4325 | brenda |
| 7086 | brenda |
| 716 | brenda |
| 96008 | brenda |
| D5M | pdbe |
| DA | pdbe |
| HMDB0000905 | hmdb |
| DTXSID901034859 | comptox |
| Molport-004-955-249 | molport |
| The data in this table is sourced from UniChem at EBI. | |