Dataset
Naringenin-7-O-glucoside; LC-ESI-QTOF; MS2
Chemical Information
| InChI | InChI=1S/C21H22O10/c22-8-16-18(26)19(27)20(28)21(31-16)29-11-5-12(24)17-13(25)7-14(30-15(17)6-11)9-1-3-10(23)4-2-9/h1-6,14,16,18-24,26-28H,7-8H2/t14-,16+,18+,19-,20+,21+/m0/s1 |
|---|---|
| SMILES | OC[C@H]1O[C@@H](OC2=CC(O)=C3C(=O)C[C@H](OC3=C2)C2=CC=C(O)C=C2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI Key | DLIKSSGEMUFQOK-SFTVRKLSSA-N |
| Molecular Formula | C21H22O10 |
| Exact Mass | 434.397 g/mol |
Data and Resources
Metadata Information
| Field | Value |
|---|---|
| DOI | |
| License URL | https://creativecommons.org/licenses/by-nc-sa/4.0 |
| Source | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-RIKEN-PR302725 |
| Version | |
| Author | |
| Maintainer | |
| Language | |
| MetadataPublished | 2019-03-28 |
| Related Molecule |
|
| Field | Value |
|---|---|
| Measurement Technique | liquid chromatography-mass spectrometry |
| Measurement Variables |
| Data-Source Molecule ID | Data-Source |
|---|---|
| 92794 | PubChem |
| 60021910 | NMRShiftDB |
| 163470660 | PubChem: Thomson Pharma |
| PD127306 | ProbesDrugs |
| LMPK12140237 | LipidMaps |
| 30512511 | eMolecules |
| MTBLC28327 | Metabolights |
| 20486 | Brenda |
| 17639 | Brenda |
| 9343 | Brenda |
| 48192 | Brenda |
| ZINC000004097895 | ZINC |
| 25127 | Brenda |
| 211876 | Brenda |
| 141761 | Brenda |
| 123352 | Brenda |
| CB7111523 | ChemicalBook |
| 110452 | Brenda |
| SCHEMBL318229 | SureChEMBL |
| 28327 | Rhea |
| HY-N1549 | MedChemExpress |
| 50249470 | BindingDB |
| J182.295K | Nikkaji |
| C09099 | KEGG Ligand |
| CHEMBL469654 | ChEMBL |
| 28327 | ChEBI |
| The data in this table is sourced from UniChem at EBI. | |