Dataset
Nicotine (not validated); LC-ESI-QTOF; MS2
Chemical Information
| InChI | InChI=1S/C10H14N2/c1-12-7-3-5-10(12)9-4-2-6-11-8-9/h2,4,6,8,10H,3,5,7H2,1H3 |
|---|---|
| SMILES | N1=CC=CC(=C1)C2N(C)CCC2 |
| InChI Key | SNICXCGAKADSCV-UHFFFAOYSA-N |
| Molecular Formula | C10H14N2 |
| Exact Mass | 162.236 g/mol |
Data and Resources
Metadata Information
| Field | Value |
|---|---|
| DOI | |
| License URL | https://creativecommons.org/licenses/by-nc-sa/4.0 |
| Source | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-RIKEN-PR310814 |
| Version | |
| Author | |
| Maintainer | |
| Language | |
| MetadataPublished | 2019-03-28 |
| Related Molecule |
|
| Field | Value |
|---|---|
| Measurement Technique | liquid chromatography-mass spectrometry |
| Measurement Variables |
| Data-Source Molecule ID | Data-Source |
|---|---|
| CHEBI:138000 | chebi |
| CHEMBL440464 | chembl |
| 11976729 | surechembl |
| 20193 | surechembl |
| 942 | pubchem |
| 2585 | gtopdb |
| 3978 | gtopdb |
| PD010183 | probes_and_drugs |
| 174991 | brenda |
| HMDB0243542 | hmdb |
| 1282820 | bindingdb |
| 1282821 | bindingdb |
| 386791 | bindingdb |
| 50313526 | bindingdb |
| 50313542 | bindingdb |
| 50997512 | bindingdb |
| 51016810 | bindingdb |
| 51020385 | bindingdb |
| 51159357 | bindingdb |
| 51159371 | bindingdb |
| 51356867 | bindingdb |
| 51356869 | bindingdb |
| 51356976 | bindingdb |
| 794478 | bindingdb |
| 794479 | bindingdb |
| 794480 | bindingdb |
| 794481 | bindingdb |
| 794482 | bindingdb |
| The data in this table is sourced from UniChem at EBI. | |