Dataset
![molecular Image]()
Thioglycolic acid solution , Mercaptoacetic acid, Mercaptoethanoic acid, Thioglycolate, Thiovanic acid, TGA, Mercaptoacetate
Chemical Info
| InChI | InChI=1S/C2H4O2S/c3-2(4)1-5/h5H,1H2,(H,3,4) |
|---|---|
| SMILES | C(C(=O)O)S |
| InChI Key | CWERGRDVMFNCDR-UHFFFAOYSA-N |
| Molecular Formula | C2H4O2S |
| Exact Mass | 92.117 g/mol |
Data and Resources
Metadata Information
| Field | Value |
|---|---|
| DOI | |
| License URL | https://creativecommons.org/licenses/by-nc/4.0 |
| Source | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-RIKEN_ReSpect-PS035407 |
| Version | |
| Author | |
| Maintainer | |
| Language | |
| MetadataCreated | 2024-01-11T21:38:21.706769 |
| MetadataModified | 2025-02-09T19:06:38.219232 |
| MetadataPublished | 2009-02-09 |
| Field | Value |
|---|---|
| Measurement Technique | liquid chromatography-mass spectrometry |
| Measurement Variables |
| Data-Source Molecule ID | Data-Source |
|---|---|
| 1133 | PubChem |
| PD122174 | ProbesDrugs |
| 14867149 | PubChem: Thomson Pharma |
| 57755-20-1 | ACToR |
| 68-11-1 | ACToR |
| 7857H94KHM | FDA SRS |
| 494137 | eMolecules |
| ZINC000004658574 | ZINC |
| CB6477604 | ChemicalBook |
| 129829565 | PubChem |
| 12602 | Brenda |
| 9213 | Brenda |
| 122013 | Brenda |
| 3098 | Brenda |
| 50992 | Brenda |
| 136115 | Brenda |
| 15988 | Brenda |
| 55690 | Brenda |
| 48869 | Brenda |
| 108116 | Brenda |
| 20200611 | NMRShiftDB |
| SCHEMBL21017 | SureChEMBL |
| MCULE-8097997001 | Mcule |
| THIOGLYCOLIC ACID | clinicaltrials |
| J4.856I | Nikkaji |
| 50336509 | BindingDB |
| 2360 | Brenda |
| 97221 | Brenda |
| DTXSID8026141 | EPA CompTox Dashboard |
| HMDB0254464 | Human Metabolome Database |
| DB15429 | DrugBank |
| C02086 | KEGG Ligand |
| CHEMBL116455 | ChEMBL |
| 30065 | ChEBI |
| MCR | PDBe |
| The data in this table is sourced from UniChem at EBI. | |