Dataset
3,4',5,7-tetrahydroxy-3'-methoxy flavone, Isorhamnetol, Tamarixetin, 3'-O-Methylquercetin, 3'-Methoxy-3,4',5,7-tetrahydroxyflavone, 3'-Methoxyquercetin, Isorhamnetin, 3-Methylquercetin, Isor
Chemical Info
InChI | InChI=1S/C16H12O7/c1-22-11-4-7(2-3-9(11)18)16-15(21)14(20)13-10(19)5-8(17)6-12(13)23-16/h2-6,17-19,21H,1H3 |
---|---|
SMILES | COC1=C(C=CC(=C1)C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O)O |
InChI Key | IZQSVPBOUDKVDZ-UHFFFAOYSA-N |
Molecular Formula | C16H12O7 |
Exact Mass | 316.265 g/mol |
Data and Resources
Metadata Information
Field | Value |
---|---|
DOI | |
License URL | https://creativecommons.org/licenses/by-nc/4.0 |
Source | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-RIKEN_ReSpect-PS040102 |
Version | |
Author | |
Maintainer | |
Language | |
MetadataCreated | 2024-01-11T21:38:48.634032 |
MetadataModified | 2025-02-09T19:05:44.958182 |
MetadataPublished | 2009-02-09 |
Field | Value |
---|---|
Measurement Technique | liquid chromatography-mass spectrometry |
Measurement Variables |
Data-Source Molecule ID | Data-Source |
---|---|
C10084 | KEGG Ligand |
CHEMBL379064 | ChEMBL |
IRH | PDBe |
91275 | Brenda |
J1.543A | Nikkaji |
ZINC000000517261 | ZINC |
LMPK12110002 | LipidMaps |
DTXSID10197379 | EPA CompTox Dashboard |
HY-N0776 | MedChemExpress |
248238 | Brenda |
248240 | Brenda |
23409 | BindingDB |
1935869 | eMolecules |
5281654 | PubChem |
14923619 | PubChem: Thomson Pharma |
60018754 | NMRShiftDB |
PD018337 | ProbesDrugs |
SCHEMBL19235 | SureChEMBL |
480-19-3 | ACToR |
6052 | ChEBI |
DB16767 | DrugBank |
07X3IB4R4Z | FDA SRS |
CB0472359 | ChemicalBook |
MTBLC6052 | Metabolights |
HMDB0002655 | Human Metabolome Database |
1977 | Brenda |
21926 | Brenda |
163963 | Brenda |
The data in this table is sourced from UniChem at EBI. |