Dataset
Indigo yellow, Popuinetin, 4H-1-Benzopyran-4-one, 5,7,4'-Trihydroxyflavonol, Trifolitin, pelargidenolon, Kaem, Kampherol, 3,5,7-trihydroxy-2-(4-hydroxyphenyl)-5,7,4'-Trihydroxyflavonol, nimbecetin, Kaempferol, rhamnolutein, Robigenin, Rhamnolutin, 3,4',5,7-tetrahydroxyflavone, Populnetin, Kempferol, Swartziol; LC-ESI-QQ; MS2
Chemical Information
| InChI | InChI=1S/C15H10O6/c16-8-3-1-7(2-4-8)15-14(20)13(19)12-10(18)5-9(17)6-11(12)21-15/h1-6,16-18,20H |
|---|---|
| SMILES | C1=CC(=CC=C1C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O)O |
| InChI Key | IYRMWMYZSQPJKC-UHFFFAOYSA-N |
| Molecular Formula | C15H10O6 |
| Exact Mass | 286.239 g/mol |
Data and Resources
Metadata Information
| Field | Value |
|---|---|
| DOI | |
| License URL | https://creativecommons.org/licenses/by-nc/4.0 |
| Source | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-RIKEN_ReSpect-PS040204 |
| Version | |
| Author | |
| Maintainer | |
| Language | |
| MetadataPublished | 2009-02-09 |
| Related Molecule |
|
| Field | Value |
|---|---|
| Measurement Technique | liquid chromatography-mass spectrometry |
| Measurement Variables |
| Data-Source Molecule ID | Data-Source |
|---|---|
| 7628 | Brenda |
| 408 | Brenda |
| HMDB0005801 | Human Metabolome Database |
| CB5223176 | ChemicalBook |
| ZINC000003869768 | ZINC |
| MTBLC28499 | Metabolights |
| 62438 | Brenda |
| 35794 | Brenda |
| SCHEMBL18817 | SureChEMBL |
| 5280863 | PubChem |
| PD000231 | ProbesDrugs |
| 14751111 | PubChem: Thomson Pharma |
| 520-18-3 | ACToR |
| Kaempferol | Selleck |
| LSM-5304 | LINCS |
| 524531 | eMolecules |
| EJEPOA | CCDC |
| J1.575J | Nikkaji |
| LMPK12110003 | LipidMaps |
| DTXSID7020768 | EPA CompTox Dashboard |
| 43511 | Brenda |
| 243651 | Brenda |
| HY-14590 | MedChemExpress |
| 11052 | Guide to Pharmacology |
| 60005037 | NMRShiftDB |
| 7462 | BindingDB |
| MCULE-8965218413 | Mcule |
| 731P2LE49E | FDA SRS |
| DB01852 | DrugBank |
| 56310599 | PubChem: Drugs of the Future |
| CHEMBL150 | ChEMBL |
| KMP | PDBe |
| 28499 | ChEBI |
| C05903 | KEGG Ligand |
| The data in this table is sourced from UniChem at EBI. | |