Dataset
Kaempferol 4'-methyl ether, 3,5,7-trihydroxy-4'-methoxyflavone, 4H-1-Benzopyran-4-one, 3,5,7-trihydroxy-2-(4-methoxyphenyl)-, Kaempferid, Kaer, Kaempferide, 4'-O-Methylkaempferol; LC-ESI-QQ; MS2
Chemical Information
| InChI | InChI=1S/C16H12O6/c1-21-10-4-2-8(3-5-10)16-15(20)14(19)13-11(18)6-9(17)7-12(13)22-16/h2-7,17-18,20H,1H3 |
|---|---|
| SMILES | COC1=CC=C(C=C1)C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O |
| InChI Key | SQFSKOYWJBQGKQ-UHFFFAOYSA-N |
| Molecular Formula | C16H12O6 |
| Exact Mass | 300.266 g/mol |
Data and Resources
Metadata Information
| Field | Value |
|---|---|
| DOI | |
| License URL | https://creativecommons.org/licenses/by-nc/4.0 |
| Source | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-RIKEN_ReSpect-PS040302 |
| Version | |
| Author | |
| Maintainer | |
| Language | |
| MetadataPublished | 2009-02-09 |
| Related Molecule |
|
| Field | Value |
|---|---|
| Measurement Technique | liquid chromatography-mass spectrometry |
| Measurement Variables |
| Data-Source Molecule ID | Data-Source |
|---|---|
| CHEBI:6099 | chebi |
| LMPK12110563 | lipidmaps |
| CHEMBL40919 | chembl |
| 29371282 | surechembl |
| 426774 | surechembl |
| 5281666 | pubchem |
| 508XL61MPD | fdasrs |
| PD012582 | probes_and_drugs |
| 111079 | brenda |
| 113689 | brenda |
| 124053 | brenda |
| 136804 | brenda |
| 13699 | brenda |
| 170372 | brenda |
| 170407 | brenda |
| 172825 | brenda |
| 172909 | brenda |
| 30766 | brenda |
| 56862 | brenda |
| HMDB0037441 | hmdb |
| DTXSID9034155 | comptox |
| Molport-000-165-394 | molport |
| 50084978 | bindingdb |
| The data in this table is sourced from UniChem at EBI. | |