Dataset
Glucoluteolin, Luteoloside, luteolin-7-O-glucoside, Luteolin 7-O-beta-D-glucoside, Cinaroside, Lutl-7-Glc, Luteolin 7-O-glucopyranoside, 7-O-beta-D-Glucosyl-5,7,3',4'-tetrahydroxyflavone, 7-Glucosylluteolin, 2-(3,4-Dihydroxyphenyl)-7-(beta-D-glucopyranosyloxy)-5-hydroxy-4H-1-benzopyran-4-one, Cynaroside; LC-ESI-QQ; MS2
Chemical Information
| InChI | InChI=1S/C21H20O11/c22-7-16-18(27)19(28)20(29)21(32-16)30-9-4-12(25)17-13(26)6-14(31-15(17)5-9)8-1-2-10(23)11(24)3-8/h1-6,16,18-25,27-29H,7H2/t16-,18-,19+,20-,21-/m1/s1 |
|---|---|
| SMILES | C1=CC(=C(C=C1C2=CC(=O)C3=C(C=C(C=C3O2)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O)O)O |
| InChI Key | PEFNSGRTCBGNAN-QNDFHXLGSA-N |
| Molecular Formula | C21H20O11 |
| Exact Mass | 448.380 g/mol |
Data and Resources
Metadata Information
| Field | Value |
|---|---|
| DOI | |
| License URL | https://creativecommons.org/licenses/by-nc/4.0 |
| Source | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-RIKEN_ReSpect-PS042611 |
| Version | |
| Author | |
| Maintainer | |
| Language | |
| MetadataPublished | 2009-02-09 |
| Related Molecule |
|
| Field | Value |
|---|---|
| Measurement Technique | liquid chromatography-mass spectrometry |
| Measurement Variables |
| Data-Source Molecule ID | Data-Source |
|---|---|
| CHEBI:27994 | chebi |
| LMPK12113403 | lipidmaps |
| CHEMBL233929 | chembl |
| 149118 | surechembl |
| 29374275 | surechembl |
| 29558199 | surechembl |
| 5280637 | pubchem |
| 98J6XDS46I | fdasrs |
| PD063636 | probes_and_drugs |
| 115984 | brenda |
| 123348 | brenda |
| 12809 | brenda |
| 141760 | brenda |
| 165116 | brenda |
| 17638 | brenda |
| 18642 | brenda |
| 229321 | brenda |
| 241955 | brenda |
| 29650 | brenda |
| 32671 | brenda |
| 3645 | brenda |
| 55908 | brenda |
| 56649 | brenda |
| 66408 | brenda |
| 96055 | brenda |
| HMDB0035588 | hmdb |
| Molport-001-740-780 | molport |
| 50241242 | bindingdb |
| The data in this table is sourced from UniChem at EBI. | |