Dataset
![molecular Image]()
1-Hydroxyethanecarboxylic acid, alpha-Hydroxypropanoic acid, 2-Hydroxypropionic acid, Lactate, 2-Hydroxy-2-methylacetic acid, Ethylidenelactic acid, Propel, Milk acid, DL-Lactic acid, Milchsaeure
Chemical Info
| InChI | InChI=1S/C3H6O3/c1-2(4)3(5)6/h2,4H,1H3,(H,5,6) |
|---|---|
| SMILES | CC(C(=O)O)O |
| InChI Key | JVTAAEKCZFNVCJ-UHFFFAOYSA-N |
| Molecular Formula | C3H6O3 |
| Exact Mass | 90.078 g/mol |
Data and Resources
Metadata Information
| Field | Value |
|---|---|
| DOI | |
| License URL | https://creativecommons.org/licenses/by-nc/4.0 |
| Source | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-RIKEN_ReSpect-PS078202 |
| Version | |
| Author | |
| Maintainer | |
| Language | |
| MetadataCreated | 2024-01-11T21:30:57.790743 |
| MetadataModified | 2025-02-09T19:06:27.554551 |
| MetadataPublished | 2009-02-09 |
| Field | Value |
|---|---|
| Measurement Technique | liquid chromatography-mass spectrometry |
| Measurement Variables |
| Data-Source Molecule ID | Data-Source |
|---|---|
| 103930 | Brenda |
| 1219 | Brenda |
| 107650 | Brenda |
| 5286 | Brenda |
| 132153 | Brenda |
| MTBLC78320 | Metabolights |
| CB1193448 | ChemicalBook |
| CB8193447 | ChemicalBook |
| 170247 | Brenda |
| 92997 | Brenda |
| 7226 | Brenda |
| 48511 | Brenda |
| SCHEMBL15902696 | SureChEMBL |
| SCHEMBL999 | SureChEMBL |
| 78320 | ChEBI |
| 8113 | NMRShiftDB |
| MCULE-5387110670 | Mcule |
| 517908 | eMolecules |
| 15146339 | PubChem: Thomson Pharma |
| 612 | PubChem |
| 19789253 | PubChem |
| 79-33-4 | ACToR |
| 26100-51-6 | ACToR |
| 152-36-3 | ACToR |
| 50-21-5 | ACToR |
| PD009375 | ProbesDrugs |
| lactic acid | Atlas |
| CHEMBL1200559 | ChEMBL |
| C01432 | KEGG Ligand |
| LACTIC ACID | rxnorm |
| DL-LACTIC ACID | rxnorm |
| MILK ACID | clinicaltrials |
| DL- LACTIC ACID | clinicaltrials |
| DL-LACTIC ACID | clinicaltrials |
| LACTIC ACID | clinicaltrials |
| 248882 | Brenda |
| DB04398 | DrugBank |
| DTXSID7023192 | EPA CompTox Dashboard |
| 1533 | DrugCentral |
| J1.358G | Nikkaji |
| 3B8D35Y7S4 | FDA SRS |
| CB3701203 | ChemicalBook |
| 221588 | Brenda |
| The data in this table is sourced from UniChem at EBI. | |