Dataset
Alloxanthine, Ossipurinolo, Oxypurinol, DHPP, Oxoallopurinol, Oxipurinol; LC-ESI-QQ; MS2
Chemical Information
| InChI | InChI=1S/C5H4N4O2/c10-4-2-1-6-9-3(2)7-5(11)8-4/h1H,(H3,6,7,8,9,10,11) |
|---|---|
| SMILES | C1=C2C(=NC(=O)NC2=O)NN1 |
| InChI Key | HXNFUBHNUDHIGC-UHFFFAOYSA-N |
| Molecular Formula | C5H4N4O2 |
| Exact Mass | 152.113 g/mol |
Data and Resources
Metadata Information
| Field | Value |
|---|---|
| DOI | |
| License URL | https://creativecommons.org/licenses/by-nc/4.0 |
| Source | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-RIKEN_ReSpect-PS101007 |
| Version | |
| Author | |
| Maintainer | |
| Language | |
| MetadataPublished | 2009-02-09 |
| Related Molecule |
|
| Field | Value |
|---|---|
| Measurement Technique | liquid chromatography-mass spectrometry |
| Measurement Variables |
| Data-Source Molecule ID | Data-Source |
|---|---|
| DB05262 | drugbank |
| CHEBI:28315 | chebi |
| 141 | rcsb_pdb |
| CHEMBL859 | chembl |
| 2017937 | surechembl |
| 2077651 | surechembl |
| 39154 | surechembl |
| 49280 | surechembl |
| 49281 | surechembl |
| 8256426 | surechembl |
| 8256749 | surechembl |
| 8256863 | surechembl |
| 8257647 | surechembl |
| 8258215 | surechembl |
| 8258318 | surechembl |
| 8258418 | surechembl |
| 8260172 | surechembl |
| 135398752 | pubchem |
| G97OZE5068 | fdasrs |
| PD008633 | probes_and_drugs |
| 16615 | brenda |
| 37694 | brenda |
| 44638 | brenda |
| 44640 | brenda |
| 51104 | brenda |
| 6865 | brenda |
| 91605 | brenda |
| 141 | pdbe |
| HMDB0000786 | hmdb |
| Molport-003-846-776 | molport |
| Molport-003-959-085 | molport |
| 50423777 | bindingdb |
| The data in this table is sourced from UniChem at EBI. | |