Dataset
2,6-Dioxo-1,2,3,6-tetrahydropurine, 2,6-Dihydroxypurine, XAN, 3,7-dihydropurine-2,6-dione, Xanthic oxide, 2,6-Dioxopurine, Xanthine
Chemical Info
InChI | InChI=1S/C5H4N4O2/c10-4-2-3(7-1-6-2)8-5(11)9-4/h1H,(H3,6,7,8,9,10,11) |
---|---|
SMILES | C1=NC2=C(N1)C(=O)NC(=O)N2 |
InChI Key | LRFVTYWOQMYALW-UHFFFAOYSA-N |
Molecular Formula | C5H4N4O2 |
Exact Mass | 152.113 g/mol |
Data and Resources
Metadata Information
Field | Value |
---|---|
DOI | |
License URL | https://creativecommons.org/licenses/by-nc/4.0 |
Source | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-RIKEN_ReSpect-PT203730 |
Version | |
Author | |
Maintainer | |
Language | |
MetadataCreated | 2024-01-11T21:39:24.986028 |
MetadataModified | 2025-02-09T19:06:35.148882 |
MetadataPublished | 2008-07-28 |
Field | Value |
---|---|
Measurement Technique | liquid chromatography-mass spectrometry |
Measurement Variables |
Data-Source Molecule ID | Data-Source |
---|---|
C00385 | KEGG Ligand |
DB02134 | DrugBank |
CHEMBL1424 | ChEMBL |
48517 | ChEBI |
17712 | ChEBI |
XAN | PDBe |
50227193 | BindingDB |
ZINC000013517187 | ZINC |
J2.371J | Nikkaji |
4557 | Guide to Pharmacology |
XANTHINE | rxnorm |
HY-W017389 | MedChemExpress |
DTXSID4035120 | EPA CompTox Dashboard |
82009 | BindingDB |
1188 | PubChem |
16275634 | PubChem: Thomson Pharma |
15120174 | PubChem: Thomson Pharma |
16142320 | PubChem: Thomson Pharma |
15946662 | PubChem: Thomson Pharma |
16819-86-6 | ACToR |
xan | Recon |
SCHEMBL4965 | SureChEMBL |
1AVZ07U9S7 | FDA SRS |
PD008524 | ProbesDrugs |
36366186 | eMolecules |
711812 | eMolecules |
533318 | eMolecules |
670435 | eMolecules |
CB0197999 | ChemicalBook |
17712 | Rhea |
MTBLC17712 | Metabolights |
234 | Brenda |
HMDB0000292 | Human Metabolome Database |
MTBLC48517 | Metabolights |
20191749 | NMRShiftDB |
MCULE-6687728468 | Mcule |
The data in this table is sourced from UniChem at EBI. |