Dataset
Ketoprofen; LC-ESI-ITFT; MS2; CE: 80; R=15000; [M+H]+
Chemical Information
| InChI | InChI=1S/C16H14O3/c1-11(16(18)19)13-8-5-9-14(10-13)15(17)12-6-3-2-4-7-12/h2-11H,1H3,(H,18,19) |
|---|---|
| SMILES | CC(C(O)=O)C1=CC=CC(=C1)C(=O)C1=CC=CC=C1 |
| InChI Key | DKYWVDODHFEZIM-UHFFFAOYSA-N |
| Molecular Formula | C16H14O3 |
| Exact Mass | 254.094 g/mol |
Data and Resources
Metadata Information
| Field | Value |
|---|---|
| DOI | |
| License URL | https://creativecommons.org/licenses/by/4.0 |
| Source | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-UFZ-UF408602 |
| Version | |
| Author | |
| Maintainer | |
| Language | |
| MetadataPublished | 2017-01-05 |
| Related Molecule |
|
| Field | Value |
|---|---|
| Measurement Technique | liquid chromatography-mass spectrometry |
| Measurement Variables |
| Data-Source Molecule ID | Data-Source |
|---|---|
| 499326 | eMolecules |
| PD001443 | ProbesDrugs |
| KETOPROFEN LYSINE | clinicaltrials |
| KETOPROFEN LYSINE SALT | clinicaltrials |
| LSM-1955 | LINCS |
| 15122326 | PubChem: Thomson Pharma |
| 154907-35-4 | ACToR |
| PA450149 | PharmGKB |
| Ketoprofen(Actron) | Selleck |
| 22071-15-4 | ACToR |
| 135254 | Brenda |
| 104478 | Brenda |
| ketoprofen | DailyMed |
| CB3299418 | ChemicalBook |
| HMDB0015144 | Human Metabolome Database |
| 55515 | Brenda |
| SCHEMBL2896 | SureChEMBL |
| 20207463 | NMRShiftDB |
| 3825 | PubChem |
| J389.200J | Nikkaji |
| J389.199B | Nikkaji |
| J3.468A | Nikkaji |
| 4795 | Guide to Pharmacology |
| 1528 | DrugCentral |
| DTXSID6020771 | EPA CompTox Dashboard |
| MCULE-9740144074 | Mcule |
| 90Y4QC304K | FDA SRS |
| 19583RP | clinicaltrials |
| IDEA-033 | clinicaltrials |
| ORUVAIL | clinicaltrials |
| ORUDIS | clinicaltrials |
| HY-B0227 | MedChemExpress |
| DIRACTIN | clinicaltrials |
| NEXCEDE | clinicaltrials |
| RP-19583 | clinicaltrials |
| ALRHEUMAT | clinicaltrials |
| KETOPROFEN | clinicaltrials |
| SECTOR | clinicaltrials |
| ACTRON | clinicaltrials |
| CAPISTEN | clinicaltrials |
| KETOPROFEN | DailyMed |
| KETOPROFEN | rxnorm |
| 50022271 | BindingDB |
| C01716 | KEGG Ligand |
| DB01009 | DrugBank |
| CHEMBL571 | ChEMBL |
| 6128 | ChEBI |
| SAM002264620 | NIH Clinical Collection |
| The data in this table is sourced from UniChem at EBI. | |