Dataset
Cycloheximide; LC-ESI-QTOF; MS2; CE 20 ev; [M+H]+
Chemical Information
| InChI | InChI=1S/C15H23NO4/c1-8-3-9(2)15(20)11(4-8)12(17)5-10-6-13(18)16-14(19)7-10/h8-12,17H,3-7H2,1-2H3,(H,16,18,19)/t8-,9-,11-,12+/m0/s1 |
|---|---|
| SMILES | C[C@H]1C[C@@H](C(=O)[C@@H](C1)[C@@H](CC2CC(=O)NC(=O)C2)O)C |
| InChI Key | YPHMISFOHDHNIV-FSZOTQKASA-N |
| Molecular Formula | C15H23NO4 |
| Exact Mass | 281.163 g/mol |
Data and Resources
Metadata Information
| Field | Value |
|---|---|
| DOI | |
| License URL | https://creativecommons.org/licenses/by-sa/4.0 |
| Source | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-Washington_State_Univ-BML00709 |
| Version | |
| Author | |
| Maintainer | |
| Language | |
| MetadataPublished | 2016-01-19 |
| Related Molecule |
|
| Field | Value |
|---|---|
| Measurement Technique | liquid chromatography-mass spectrometry |
| Measurement Variables |
| Data-Source Molecule ID | Data-Source |
|---|---|
| 5433 | Guide to Pharmacology |
| DTXSID6024882 | EPA CompTox Dashboard |
| 229307 | Brenda |
| 229308 | Brenda |
| 27641 | Rhea |
| J107.994H | Nikkaji |
| 50080528 | BindingDB |
| 27641 | ChEBI |
| C06685 | KEGG Ligand |
| CHEMBL123292 | ChEMBL |
| 105779 | Brenda |
| 153430 | Brenda |
| ZINC000003872170 | ZINC |
| MTBLC27641 | Metabolights |
| 105780 | Brenda |
| 154420 | Brenda |
| 135374 | Brenda |
| 1715 | Brenda |
| SCHEMBL26617 | SureChEMBL |
| 6197 | PubChem |
| 60146035 | NMRShiftDB |
| PD001378 | ProbesDrugs |
| cycloheximide | Atlas |
| 16602052 | PubChem: Thomson Pharma |
| LSM-2791 | LINCS |
| 66-81-9 | ACToR |
| 3HE | PDBe |
| 98600C0908 | FDA SRS |
| 474920 | eMolecules |
| 29817042 | eMolecules |
| The data in this table is sourced from UniChem at EBI. | |