Dataset
4-Methylumbelliferyl glucuronide
Chemical Info
InChI | InChI=1S/C16H16O9/c1-6-4-10(17)24-9-5-7(2-3-8(6)9)23-16-13(20)11(18)12(19)14(25-16)15(21)22/h2-5,11-14,16,18-20H,1H3,(H,21,22)/t11-,12-,13+,14-,16+/m0/s1 |
---|---|
SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)C(=O)O)O)O)O |
InChI Key | ARQXEQLMMNGFDU-JHZZJYKESA-N |
Molecular Formula | C16H16O9 |
Exact Mass | 352.079 g/mol |
Data and Resources
Metadata Information
Field | Value |
---|---|
DOI | |
License URL | https://creativecommons.org/licenses/by-sa/4.0 |
Source | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-Washington_State_Univ-BML80431 |
Version | |
Author | |
Maintainer | |
Language | |
MetadataCreated | 2024-01-11T22:25:47.350642 |
MetadataModified | 2024-01-11T22:25:47.519075 |
MetadataPublished | 2016-01-19 |
Field | Value |
---|---|
Measurement Technique | liquid chromatography-mass spectrometry |
Measurement Variables |
Data-Source Molecule ID | Data-Source |
---|---|
CHEMBL1592343 | ChEMBL |
C11584 | KEGG Ligand |
885661 | eMolecules |
PD008008 | ProbesDrugs |
15417 | Brenda |
91553 | PubChem |
30138-68-2 | ACToR |
14827807 | PubChem: Thomson Pharma |
4212 | Brenda |
J211.426G | Nikkaji |
SCHEMBL110946 | SureChEMBL |
253568 | Brenda |
HMDB0240464 | Human Metabolome Database |
126933 | Brenda |
150101 | Brenda |
150102 | Brenda |
62888 | Brenda |
211127 | Brenda |
19800 | Brenda |
150100 | Brenda |
150104 | Brenda |
DTXSID10891502 | EPA CompTox Dashboard |
126934 | Brenda |
233060 | Brenda |
1904 | ChEBI |
ZINC000004073886 | ZINC |
The data in this table is sourced from UniChem at EBI. |