Dataset
Pizotifen; LC-ESI-Q; MS; POS; 60 V
Chemical Information
| InChI | InChI=1S/C19H21NS/c1-20-11-8-15(9-12-20)19-16-5-3-2-4-14(16)6-7-18-17(19)10-13-21-18/h2-5,10,13H,6-9,11-12H2,1H3 |
|---|---|
| SMILES | CN(C4)CCC(C4)=C(c21)c(c3)c(sc3)CCc(cccc2)1 |
| InChI Key | FIADGNVRKBPQEU-UHFFFAOYSA-N |
| Molecular Formula | C19H21NS |
| Exact Mass | 295.139 g/mol |
Data and Resources
Metadata Information
| Field | Value |
|---|---|
| DOI | |
| License URL | https://creativecommons.org/licenses/by-nc/4.0 |
| Source | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-Waters-WA000478 |
| Version | |
| Author | |
| Maintainer | |
| Language | |
| MetadataPublished | 2016-01-19 |
| Related Molecule |
|
| Field | Value |
|---|---|
| Measurement Technique | liquid chromatography-mass spectrometry |
| Measurement Variables |
| Data-Source Molecule ID | Data-Source |
|---|---|
| 24714723 | PubChem: Drugs of the Future |
| CHEMBL294951 | ChEMBL |
| 93 | Guide to Pharmacology |
| HMDB0256623 | Human Metabolome Database |
| ZINC000000001968 | ZINC |
| 2220 | DrugCentral |
| DTXSID6023490 | EPA CompTox Dashboard |
| HY-B0115 | MedChemExpress |
| PIZOTYLINE | rxnorm |
| J9.608C | Nikkaji |
| 82088 | BindingDB |
| DB06153 | DrugBank |
| 211941 | Brenda |
| CB4230373 | ChemicalBook |
| MCULE-5738749931 | Mcule |
| 27400 | PubChem |
| PD012413 | ProbesDrugs |
| 50212 | ChEBI |
| 0BY8440V3N | FDA SRS |
| 14751522 | PubChem: Thomson Pharma |
| 15574-96-6 | ACToR |
| SCHEMBL44122 | SureChEMBL |
| LSM-3695 | LINCS |
| 1933753 | eMolecules |
| The data in this table is sourced from UniChem at EBI. | |