Dataset
Amprenavir; LC-ESI-Q; MS; POS; 90 V
Chemical Information
| InChI | InChI=1S/C25H35N3O6S/c1-18(2)15-28(35(31,32)22-10-8-20(26)9-11-22)16-24(29)23(14-19-6-4-3-5-7-19)27-25(30)34-21-12-13-33-17-21/h3-11,18,21,23-24,29H,12-17,26H2,1-2H3,(H,27,30)/t21-,23-,24+/m0/s1 |
|---|---|
| SMILES | CC(C)CN(CC(O)C(NC(=O)OC(C3)COC3)Cc(c2)cccc2)S(=O)(=O)c(c1)ccc(N)c1 |
| InChI Key | YMARZQAQMVYCKC-OEMFJLHTSA-N |
| Molecular Formula | C25H35N3O6S |
| Exact Mass | 505.225 g/mol |
Data and Resources
Metadata Information
| Field | Value |
|---|---|
| DOI | |
| License URL | https://creativecommons.org/licenses/by-nc/4.0 |
| Source | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-Waters-WA001168 |
| Version | |
| Author | |
| Maintainer | |
| Language | |
| MetadataPublished | 2016-01-19 |
| Related Molecule |
|
| Field | Value |
|---|---|
| Measurement Technique | liquid chromatography-mass spectrometry |
| Measurement Variables |
| Data-Source Molecule ID | Data-Source |
|---|---|
| PD010072 | ProbesDrugs |
| 14884574 | PubChem: Thomson Pharma |
| 14835820 | PubChem: Thomson Pharma |
| Amprenavir-(Agenerase) | Selleck |
| 65016 | PubChem |
| 5S0W860XNR | FDA SRS |
| 877446 | eMolecules |
| 40050 | ChEBI |
| MCULE-8147835017 | Mcule |
| SCHEMBL34151 | SureChEMBL |
| HMDB0014839 | Human Metabolome Database |
| CB4186139 | ChemicalBook |
| 1608 | Brenda |
| ZINC000003809192 | ZINC |
| PA448422 | PharmGKB |
| DB00701 | DrugBank |
| C08086 | KEGG Ligand |
| CHEMBL116 | ChEMBL |
| 478 | PDBe |
| 12014852 | PubChem: Drugs of the Future |
| J1.015.291G | Nikkaji |
| 200 | DrugCentral |
| 229162 | Brenda |
| AMPRENAVIR | rxnorm |
| AGENERASE | clinicaltrials |
| 577 | BindingDB |
| 141W94 | clinicaltrials |
| AMPRENAVIR | clinicaltrials |
| VX-478 | clinicaltrials |
| 141 W94 | clinicaltrials |
| KVX-478 | clinicaltrials |
| AMPRENAVIR | DailyMed |
| HY-17430 | MedChemExpress |
| 229161 | Brenda |
| 50215393 | BindingDB |
| The data in this table is sourced from UniChem at EBI. | |